About 9-benzyl-3-ethylpurine-2,6-dione
9-benzyl-3-ethylpurine-2,6-dione (PubChem CID 174396588) has the molecular formula C14H14N4O2
and a molecular weight of 270.29 g/mol. Its IUPAC name is 9-benzyl-3-ethylpurine-2,6-dione.
Molecular Properties
| Compound Name | 9-benzyl-3-ethylpurine-2,6-dione |
| PubChem CID | 174396588 |
| Molecular Formula | C14H14N4O2 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 9-benzyl-3-ethylpurine-2,6-dione |
| SMILES | CCn1c(=O)[nH]c(=O)c2ncn(Cc3ccccc3)c21 |
| InChI | InChI=1S/C14H14N4O2/c1-2-18-13-11(12(19)16-14(18)20)15-9-17(13)8-10-6-4-3-5-7-10/h3-7,9H,2,8H2,1H3,(H,16,19,20) |
| InChIKey | GRFMJEDSAOBEPT-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 9-benzyl-3-ethylpurine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-benzyl-3-ethylpurine-2,6-dione?
The IUPAC name of 9-benzyl-3-ethylpurine-2,6-dione (CID 174396588) is 9-benzyl-3-ethylpurine-2,6-dione.
What is the SMILES notation for 9-benzyl-3-ethylpurine-2,6-dione?
The canonical SMILES for 9-benzyl-3-ethylpurine-2,6-dione is CCn1c(=O)[nH]c(=O)c2ncn(Cc3ccccc3)c21.
What is the InChIKey of 9-benzyl-3-ethylpurine-2,6-dione?
The InChIKey is GRFMJEDSAOBEPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N4O2/c1-2-18-13-11(12(19)16-14(18)20)15-9-17(13)8-10-6-4-3-5-7-10/h3-7,9H,2,8H2,1H3,(H,16,19,20).
What are the key properties of 9-benzyl-3-ethylpurine-2,6-dione?
9-benzyl-3-ethylpurine-2,6-dione has a molecular weight of 270.29 g/mol, XLogP of 0.95, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 9-benzyl-3-ethylpurine-2,6-dione is sourced from PubChem (CID 174396588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).