About 4-chloro-2-methylbutanal;thiophene
4-chloro-2-methylbutanal;thiophene (PubChem CID 174396620) has the molecular formula C9H13ClOS
and a molecular weight of 204.72 g/mol. Its IUPAC name is 4-chloro-2-methylbutanal;thiophene.
Molecular Properties
| Compound Name | 4-chloro-2-methylbutanal;thiophene |
| PubChem CID | 174396620 |
| Molecular Formula | C9H13ClOS |
| Molecular Weight | 204.72 g/mol |
| Exact Mass | 204.04 |
| IUPAC Name | 4-chloro-2-methylbutanal;thiophene |
| SMILES | CC(C=O)CCCl.c1ccsc1 |
| InChI | InChI=1S/C5H9ClO.C4H4S/c1-5(4-7)2-3-6;1-2-4-5-3-1/h4-5H,2-3H2,1H3;1-4H |
| InChIKey | RKMZYOITUDHAAZ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.72 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-2-methylbutanal;thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-methylbutanal;thiophene?
The IUPAC name of 4-chloro-2-methylbutanal;thiophene (CID 174396620) is 4-chloro-2-methylbutanal;thiophene.
What is the SMILES notation for 4-chloro-2-methylbutanal;thiophene?
The canonical SMILES for 4-chloro-2-methylbutanal;thiophene is CC(C=O)CCCl.c1ccsc1.
What is the InChIKey of 4-chloro-2-methylbutanal;thiophene?
The InChIKey is RKMZYOITUDHAAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9ClO.C4H4S/c1-5(4-7)2-3-6;1-2-4-5-3-1/h4-5H,2-3H2,1H3;1-4H.
What are the key properties of 4-chloro-2-methylbutanal;thiophene?
4-chloro-2-methylbutanal;thiophene has a molecular weight of 204.72 g/mol, XLogP of 3.20, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-methylbutanal;thiophene is sourced from PubChem (CID 174396620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).