About 2-chloroprop-2-enyl N,N-bis(sulfanyl)carbamate
2-chloroprop-2-enyl N,N-bis(sulfanyl)carbamate (PubChem CID 174397624) has the molecular formula C4H6ClNO2S2
and a molecular weight of 199.68 g/mol. Its IUPAC name is 2-chloroprop-2-enyl N,N-bis(sulfanyl)carbamate.
Molecular Properties
| Compound Name | 2-chloroprop-2-enyl N,N-bis(sulfanyl)carbamate |
| PubChem CID | 174397624 |
| Molecular Formula | C4H6ClNO2S2 |
| Molecular Weight | 199.68 g/mol |
| Exact Mass | 198.95 |
| IUPAC Name | 2-chloroprop-2-enyl N,N-bis(sulfanyl)carbamate |
| SMILES | C=C(Cl)COC(=O)N(S)S |
| InChI | InChI=1S/C4H6ClNO2S2/c1-3(5)2-8-4(7)6(9)10/h9-10H,1-2H2 |
| InChIKey | FDANUUSIQWVUON-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 29.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.68 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-chloroprop-2-enyl N,N-bis(sulfanyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloroprop-2-enyl N,N-bis(sulfanyl)carbamate?
The IUPAC name of 2-chloroprop-2-enyl N,N-bis(sulfanyl)carbamate (CID 174397624) is 2-chloroprop-2-enyl N,N-bis(sulfanyl)carbamate.
What is the SMILES notation for 2-chloroprop-2-enyl N,N-bis(sulfanyl)carbamate?
The canonical SMILES for 2-chloroprop-2-enyl N,N-bis(sulfanyl)carbamate is C=C(Cl)COC(=O)N(S)S.
What is the InChIKey of 2-chloroprop-2-enyl N,N-bis(sulfanyl)carbamate?
The InChIKey is FDANUUSIQWVUON-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6ClNO2S2/c1-3(5)2-8-4(7)6(9)10/h9-10H,1-2H2.
What are the key properties of 2-chloroprop-2-enyl N,N-bis(sulfanyl)carbamate?
2-chloroprop-2-enyl N,N-bis(sulfanyl)carbamate has a molecular weight of 199.68 g/mol, XLogP of 1.87, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloroprop-2-enyl N,N-bis(sulfanyl)carbamate is sourced from PubChem (CID 174397624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).