C24H25NO3S — CID 174397732
N-(2-ethylphenyl)-3-phenylprop-2-en-1-imine;4-methylbenzenesulfonic acid (PubChem CID 174397732) has the molecular formula C24H25NO3S and a molecular weight of 407.54 g/mol. Its IUPAC name is N-(2-ethylphenyl)-3-phenylprop-2-en-1-imine;4-methylbenzenesulfonic acid.
| Compound Name | N-(2-ethylphenyl)-3-phenylprop-2-en-1-imine;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 174397732 |
| Molecular Formula | C24H25NO3S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | N-(2-ethylphenyl)-3-phenylprop-2-en-1-imine;4-methylbenzenesulfonic acid |
| SMILES | CCc1ccccc1/N=C/C=Cc1ccccc1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C17H17N.C7H8O3S/c1-2-16-12-6-7-13-17(16)18-14-8-11-15-9-4-3-5-10-15;1-6-2-4-7(5-3-6)11(8,9)10/h3-14H,2H2,1H3;2-5H,1H3,(H,8,9,10)/b11-8?,18-14+; |
| InChIKey | HDUKUFNRMYBVKV-YCXOHMOVSA-N |
| XLogP | 5.91 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|