About 4-[5-[5,7,8-tris(methylamino)-2H-chromen-3-yl]-1H-pyrrol-2-yl]benzoic acid
4-[5-[5,7,8-tris(methylamino)-2H-chromen-3-yl]-1H-pyrrol-2-yl]benzoic acid (PubChem CID 174398021) has the molecular formula C23H24N4O3
and a molecular weight of 404.47 g/mol. Its IUPAC name is 4-[5-[5,7,8-tris(methylamino)-2H-chromen-3-yl]-1H-pyrrol-2-yl]benzoic acid.
Molecular Properties
| Compound Name | 4-[5-[5,7,8-tris(methylamino)-2H-chromen-3-yl]-1H-pyrrol-2-yl]benzoic acid |
| PubChem CID | 174398021 |
| Molecular Formula | C23H24N4O3 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 4-[5-[5,7,8-tris(methylamino)-2H-chromen-3-yl]-1H-pyrrol-2-yl]benzoic acid |
| SMILES | CNc1cc(NC)c(NC)c2c1C=C(c1ccc(-c3ccc(C(=O)O)cc3)[nH]1)CO2 |
| InChI | InChI=1S/C23H24N4O3/c1-24-19-11-20(25-2)21(26-3)22-16(19)10-15(12-30-22)18-9-8-17(27-18)13-4-6-14(7-5-13)23(28)29/h4-11,24-27H,12H2,1-3H3,(H,28,29) |
| InChIKey | RLZFPVVDEZWQDJ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 98.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[5-[5,7,8-tris(methylamino)-2H-chromen-3-yl]-1H-pyrrol-2-yl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-[5,7,8-tris(methylamino)-2H-chromen-3-yl]-1H-pyrrol-2-yl]benzoic acid?
The IUPAC name of 4-[5-[5,7,8-tris(methylamino)-2H-chromen-3-yl]-1H-pyrrol-2-yl]benzoic acid (CID 174398021) is 4-[5-[5,7,8-tris(methylamino)-2H-chromen-3-yl]-1H-pyrrol-2-yl]benzoic acid.
What is the SMILES notation for 4-[5-[5,7,8-tris(methylamino)-2H-chromen-3-yl]-1H-pyrrol-2-yl]benzoic acid?
The canonical SMILES for 4-[5-[5,7,8-tris(methylamino)-2H-chromen-3-yl]-1H-pyrrol-2-yl]benzoic acid is CNc1cc(NC)c(NC)c2c1C=C(c1ccc(-c3ccc(C(=O)O)cc3)[nH]1)CO2.
What is the InChIKey of 4-[5-[5,7,8-tris(methylamino)-2H-chromen-3-yl]-1H-pyrrol-2-yl]benzoic acid?
The InChIKey is RLZFPVVDEZWQDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24N4O3/c1-24-19-11-20(25-2)21(26-3)22-16(19)10-15(12-30-22)18-9-8-17(27-18)13-4-6-14(7-5-13)23(28)29/h4-11,24-27H,12H2,1-3H3,(H,28,29).
What are the key properties of 4-[5-[5,7,8-tris(methylamino)-2H-chromen-3-yl]-1H-pyrrol-2-yl]benzoic acid?
4-[5-[5,7,8-tris(methylamino)-2H-chromen-3-yl]-1H-pyrrol-2-yl]benzoic acid has a molecular weight of 404.47 g/mol, XLogP of 4.44, 6 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-[5,7,8-tris(methylamino)-2H-chromen-3-yl]-1H-pyrrol-2-yl]benzoic acid is sourced from PubChem (CID 174398021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).