C16H26Si — CID 174398139
4-[2-(4-ethylphenyl)ethyl]-1-methylsilinane (PubChem CID 174398139) has the molecular formula C16H26Si and a molecular weight of 246.47 g/mol. Its IUPAC name is 4-[2-(4-ethylphenyl)ethyl]-1-methylsilinane.
| Compound Name | 4-[2-(4-ethylphenyl)ethyl]-1-methylsilinane |
|---|---|
| PubChem CID | 174398139 |
| Molecular Formula | C16H26Si |
| Molecular Weight | 246.47 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | 4-[2-(4-ethylphenyl)ethyl]-1-methylsilinane |
| SMILES | CCc1ccc(CCC2CC[SiH](C)CC2)cc1 |
| InChI | InChI=1S/C16H26Si/c1-3-14-4-6-15(7-5-14)8-9-16-10-12-17(2)13-11-16/h4-7,16-17H,3,8-13H2,1-2H3 |
| InChIKey | UQYZGDSUMPIZHK-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.47 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|