About acetonitrile;N-(2,3-dimethylcyclohexa-2,4-dien-1-ylidene)hydroxylamine
acetonitrile;N-(2,3-dimethylcyclohexa-2,4-dien-1-ylidene)hydroxylamine (PubChem CID 174398599) has the molecular formula C10H14N2O
and a molecular weight of 178.23 g/mol. Its IUPAC name is acetonitrile;N-(2,3-dimethylcyclohexa-2,4-dien-1-ylidene)hydroxylamine.
Molecular Properties
| Compound Name | acetonitrile;N-(2,3-dimethylcyclohexa-2,4-dien-1-ylidene)hydroxylamine |
| PubChem CID | 174398599 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | acetonitrile;N-(2,3-dimethylcyclohexa-2,4-dien-1-ylidene)hydroxylamine |
| SMILES | CC#N.CC1=C(C)C(=NO)CC=C1 |
| InChI | InChI=1S/C8H11NO.C2H3N/c1-6-4-3-5-8(9-10)7(6)2;1-2-3/h3-4,10H,5H2,1-2H3;1H3 |
| InChIKey | GYYFULQHSZUJLE-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 56.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze acetonitrile;N-(2,3-dimethylcyclohexa-2,4-dien-1-ylidene)hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;N-(2,3-dimethylcyclohexa-2,4-dien-1-ylidene)hydroxylamine?
The IUPAC name of acetonitrile;N-(2,3-dimethylcyclohexa-2,4-dien-1-ylidene)hydroxylamine (CID 174398599) is acetonitrile;N-(2,3-dimethylcyclohexa-2,4-dien-1-ylidene)hydroxylamine.
What is the SMILES notation for acetonitrile;N-(2,3-dimethylcyclohexa-2,4-dien-1-ylidene)hydroxylamine?
The canonical SMILES for acetonitrile;N-(2,3-dimethylcyclohexa-2,4-dien-1-ylidene)hydroxylamine is CC#N.CC1=C(C)C(=NO)CC=C1.
What is the InChIKey of acetonitrile;N-(2,3-dimethylcyclohexa-2,4-dien-1-ylidene)hydroxylamine?
The InChIKey is GYYFULQHSZUJLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO.C2H3N/c1-6-4-3-5-8(9-10)7(6)2;1-2-3/h3-4,10H,5H2,1-2H3;1H3.
What are the key properties of acetonitrile;N-(2,3-dimethylcyclohexa-2,4-dien-1-ylidene)hydroxylamine?
acetonitrile;N-(2,3-dimethylcyclohexa-2,4-dien-1-ylidene)hydroxylamine has a molecular weight of 178.23 g/mol, XLogP of 2.64, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;N-(2,3-dimethylcyclohexa-2,4-dien-1-ylidene)hydroxylamine is sourced from PubChem (CID 174398599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).