C17H20FN3O2 — CID 17439897
1-(4-fluorophenyl)-N-(2-methoxyethyl)-4,5,6,7-tetrahydroindazole-3-carboxamide (PubChem CID 17439897) has the molecular formula C17H20FN3O2 and a molecular weight of 317.36 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-(2-methoxyethyl)-4,5,6,7-tetrahydroindazole-3-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-N-(2-methoxyethyl)-4,5,6,7-tetrahydroindazole-3-carboxamide |
|---|---|
| PubChem CID | 17439897 |
| Molecular Formula | C17H20FN3O2 |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | 1-(4-fluorophenyl)-N-(2-methoxyethyl)-4,5,6,7-tetrahydroindazole-3-carboxamide |
| SMILES | COCCNC(=O)c1nn(-c2ccc(F)cc2)c2c1CCCC2 |
| InChI | InChI=1S/C17H20FN3O2/c1-23-11-10-19-17(22)16-14-4-2-3-5-15(14)21(20-16)13-8-6-12(18)7-9-13/h6-9H,2-5,10-11H2,1H3,(H,19,22) |
| InChIKey | CNBYDKKWUBXNQY-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|