C23H22N2O5 — CID 174399139
2,4-dioxo-1H-pyrimidine-6-carboxylic acid;1,2,3,6-tetrahydrochrysene;hydrate (PubChem CID 174399139) has the molecular formula C23H22N2O5 and a molecular weight of 406.44 g/mol. Its IUPAC name is 2,4-dioxo-1H-pyrimidine-6-carboxylic acid;1,2,3,6-tetrahydrochrysene;hydrate.
| Compound Name | 2,4-dioxo-1H-pyrimidine-6-carboxylic acid;1,2,3,6-tetrahydrochrysene;hydrate |
|---|---|
| PubChem CID | 174399139 |
| Molecular Formula | C23H22N2O5 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 2,4-dioxo-1H-pyrimidine-6-carboxylic acid;1,2,3,6-tetrahydrochrysene;hydrate |
| SMILES | C1=c2c(ccc3c2=CCc2ccccc2-3)CCC1.O.O=C(O)c1cc(=O)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C18H16.C5H4N2O4.H2O/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18;8-3-1-2(4(9)10)6-5(11)7-3;/h1,3,5,7-8,10-12H,2,4,6,9H2;1H,(H,9,10)(H2,6,7,8,11);1H2 |
| InChIKey | QFTWGVPHJREEIP-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 134.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |