C24H23BrN2 — CID 174399284
(4R)-7-bromo-4-ethyl-1,2,3,4-tetrahydrochrysene;pyrazine (PubChem CID 174399284) has the molecular formula C24H23BrN2 and a molecular weight of 419.37 g/mol. Its IUPAC name is (4R)-7-bromo-4-ethyl-1,2,3,4-tetrahydrochrysene;pyrazine.
| Compound Name | (4R)-7-bromo-4-ethyl-1,2,3,4-tetrahydrochrysene;pyrazine |
|---|---|
| PubChem CID | 174399284 |
| Molecular Formula | C24H23BrN2 |
| Molecular Weight | 419.37 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | (4R)-7-bromo-4-ethyl-1,2,3,4-tetrahydrochrysene;pyrazine |
| SMILES | CC[C@@H]1CCCc2ccc3c(ccc4c(Br)cccc43)c21.c1cnccn1 |
| InChI | InChI=1S/C20H19Br.C4H4N2/c1-2-13-5-3-6-14-9-10-16-15-7-4-8-19(21)17(15)11-12-18(16)20(13)14;1-2-6-4-3-5-1/h4,7-13H,2-3,5-6H2,1H3;1-4H/t13-;/m1./s1 |
| InChIKey | YLEZCNKMMLQGRO-BTQNPOSSSA-N |
| XLogP | 7.06 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.37 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|