C5H10F5N — CID 174399359
N,N-dimethylmethanamine;1,1,1,2,2-pentafluoroethane (PubChem CID 174399359) has the molecular formula C5H10F5N and a molecular weight of 179.13 g/mol. Its IUPAC name is N,N-dimethylmethanamine;1,1,1,2,2-pentafluoroethane.
| Compound Name | N,N-dimethylmethanamine;1,1,1,2,2-pentafluoroethane |
|---|---|
| PubChem CID | 174399359 |
| Molecular Formula | C5H10F5N |
| Molecular Weight | 179.13 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | N,N-dimethylmethanamine;1,1,1,2,2-pentafluoroethane |
| SMILES | CN(C)C.FC(F)C(F)(F)F |
| InChI | InChI=1S/C3H9N.C2HF5/c1-4(2)3;3-1(4)2(5,6)7/h1-3H3;1H |
| InChIKey | RGVHISNMQZPPJH-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.13 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|