About fluoromethane;1,1,2,2-tetrachloroethene
fluoromethane;1,1,2,2-tetrachloroethene (PubChem CID 174399614) has the molecular formula C3H3Cl4F
and a molecular weight of 199.87 g/mol. Its IUPAC name is fluoromethane;1,1,2,2-tetrachloroethene.
Molecular Properties
| Compound Name | fluoromethane;1,1,2,2-tetrachloroethene |
| PubChem CID | 174399614 |
| Molecular Formula | C3H3Cl4F |
| Molecular Weight | 199.87 g/mol |
| Exact Mass | 197.90 |
| IUPAC Name | fluoromethane;1,1,2,2-tetrachloroethene |
| SMILES | CF.ClC(Cl)=C(Cl)Cl |
| InChI | InChI=1S/C2Cl4.CH3F/c3-1(4)2(5)6;1-2/h;1H3 |
| InChIKey | PKUVTVINRUFQTK-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.87 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze fluoromethane;1,1,2,2-tetrachloroethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoromethane;1,1,2,2-tetrachloroethene?
The IUPAC name of fluoromethane;1,1,2,2-tetrachloroethene (CID 174399614) is fluoromethane;1,1,2,2-tetrachloroethene.
What is the SMILES notation for fluoromethane;1,1,2,2-tetrachloroethene?
The canonical SMILES for fluoromethane;1,1,2,2-tetrachloroethene is CF.ClC(Cl)=C(Cl)Cl.
What is the InChIKey of fluoromethane;1,1,2,2-tetrachloroethene?
The InChIKey is PKUVTVINRUFQTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C2Cl4.CH3F/c3-1(4)2(5)6;1-2/h;1H3.
What are the key properties of fluoromethane;1,1,2,2-tetrachloroethene?
fluoromethane;1,1,2,2-tetrachloroethene has a molecular weight of 199.87 g/mol, XLogP of 3.65, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for fluoromethane;1,1,2,2-tetrachloroethene is sourced from PubChem (CID 174399614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).