About (2S)-2-[(2-ethoxyacetyl)amino]-N-[(1S)-5-methylcyclohexa-2,4-dien-1-yl]propanamide
(2S)-2-[(2-ethoxyacetyl)amino]-N-[(1S)-5-methylcyclohexa-2,4-dien-1-yl]propanamide (PubChem CID 174399870) has the molecular formula C14H22N2O3
and a molecular weight of 266.34 g/mol. Its IUPAC name is (2S)-2-[(2-ethoxyacetyl)amino]-N-[(1S)-5-methylcyclohexa-2,4-dien-1-yl]propanamide.
Molecular Properties
| Compound Name | (2S)-2-[(2-ethoxyacetyl)amino]-N-[(1S)-5-methylcyclohexa-2,4-dien-1-yl]propanamide |
| PubChem CID | 174399870 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | (2S)-2-[(2-ethoxyacetyl)amino]-N-[(1S)-5-methylcyclohexa-2,4-dien-1-yl]propanamide |
| SMILES | CCOCC(=O)N[C@@H](C)C(=O)N[C@@H]1C=CC=C(C)C1 |
| InChI | InChI=1S/C14H22N2O3/c1-4-19-9-13(17)15-11(3)14(18)16-12-7-5-6-10(2)8-12/h5-7,11-12H,4,8-9H2,1-3H3,(H,15,17)(H,16,18)/t11-,12+/m0/s1 |
| InChIKey | MPFSNPOXLZJDDN-NWDGAFQWSA-N |
| XLogP | 0.92 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-2-[(2-ethoxyacetyl)amino]-N-[(1S)-5-methylcyclohexa-2,4-dien-1-yl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[(2-ethoxyacetyl)amino]-N-[(1S)-5-methylcyclohexa-2,4-dien-1-yl]propanamide?
The IUPAC name of (2S)-2-[(2-ethoxyacetyl)amino]-N-[(1S)-5-methylcyclohexa-2,4-dien-1-yl]propanamide (CID 174399870) is (2S)-2-[(2-ethoxyacetyl)amino]-N-[(1S)-5-methylcyclohexa-2,4-dien-1-yl]propanamide.
What is the SMILES notation for (2S)-2-[(2-ethoxyacetyl)amino]-N-[(1S)-5-methylcyclohexa-2,4-dien-1-yl]propanamide?
The canonical SMILES for (2S)-2-[(2-ethoxyacetyl)amino]-N-[(1S)-5-methylcyclohexa-2,4-dien-1-yl]propanamide is CCOCC(=O)N[C@@H](C)C(=O)N[C@@H]1C=CC=C(C)C1.
What is the InChIKey of (2S)-2-[(2-ethoxyacetyl)amino]-N-[(1S)-5-methylcyclohexa-2,4-dien-1-yl]propanamide?
The InChIKey is MPFSNPOXLZJDDN-NWDGAFQWSA-N. The full InChI is InChI=1S/C14H22N2O3/c1-4-19-9-13(17)15-11(3)14(18)16-12-7-5-6-10(2)8-12/h5-7,11-12H,4,8-9H2,1-3H3,(H,15,17)(H,16,18)/t11-,12+/m0/s1.
What are the key properties of (2S)-2-[(2-ethoxyacetyl)amino]-N-[(1S)-5-methylcyclohexa-2,4-dien-1-yl]propanamide?
(2S)-2-[(2-ethoxyacetyl)amino]-N-[(1S)-5-methylcyclohexa-2,4-dien-1-yl]propanamide has a molecular weight of 266.34 g/mol, XLogP of 0.92, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[(2-ethoxyacetyl)amino]-N-[(1S)-5-methylcyclohexa-2,4-dien-1-yl]propanamide is sourced from PubChem (CID 174399870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).