About hexyl-oxo-[1-(2,4,6-trimethylbenzoyl)cyclopentyl]phosphanium
hexyl-oxo-[1-(2,4,6-trimethylbenzoyl)cyclopentyl]phosphanium (PubChem CID 174400594) has the molecular formula C21H32O2P+
and a molecular weight of 347.46 g/mol. Its IUPAC name is hexyl-oxo-[1-(2,4,6-trimethylbenzoyl)cyclopentyl]phosphanium.
Molecular Properties
| Compound Name | hexyl-oxo-[1-(2,4,6-trimethylbenzoyl)cyclopentyl]phosphanium |
| PubChem CID | 174400594 |
| Molecular Formula | C21H32O2P+ |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | hexyl-oxo-[1-(2,4,6-trimethylbenzoyl)cyclopentyl]phosphanium |
| SMILES | CCCCCC[P+](=O)C1(C(=O)c2c(C)cc(C)cc2C)CCCC1 |
| InChI | InChI=1S/C21H32O2P/c1-5-6-7-10-13-24(23)21(11-8-9-12-21)20(22)19-17(3)14-16(2)15-18(19)4/h14-15H,5-13H2,1-4H3/q+1 |
| InChIKey | PIKNEVBHIMNWIA-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze hexyl-oxo-[1-(2,4,6-trimethylbenzoyl)cyclopentyl]phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexyl-oxo-[1-(2,4,6-trimethylbenzoyl)cyclopentyl]phosphanium?
The IUPAC name of hexyl-oxo-[1-(2,4,6-trimethylbenzoyl)cyclopentyl]phosphanium (CID 174400594) is hexyl-oxo-[1-(2,4,6-trimethylbenzoyl)cyclopentyl]phosphanium.
What is the SMILES notation for hexyl-oxo-[1-(2,4,6-trimethylbenzoyl)cyclopentyl]phosphanium?
The canonical SMILES for hexyl-oxo-[1-(2,4,6-trimethylbenzoyl)cyclopentyl]phosphanium is CCCCCC[P+](=O)C1(C(=O)c2c(C)cc(C)cc2C)CCCC1.
What is the InChIKey of hexyl-oxo-[1-(2,4,6-trimethylbenzoyl)cyclopentyl]phosphanium?
The InChIKey is PIKNEVBHIMNWIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H32O2P/c1-5-6-7-10-13-24(23)21(11-8-9-12-21)20(22)19-17(3)14-16(2)15-18(19)4/h14-15H,5-13H2,1-4H3/q+1.
What are the key properties of hexyl-oxo-[1-(2,4,6-trimethylbenzoyl)cyclopentyl]phosphanium?
hexyl-oxo-[1-(2,4,6-trimethylbenzoyl)cyclopentyl]phosphanium has a molecular weight of 347.46 g/mol, XLogP of 6.52, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hexyl-oxo-[1-(2,4,6-trimethylbenzoyl)cyclopentyl]phosphanium is sourced from PubChem (CID 174400594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).