About N-butyl-N-[(5,6-dioxocyclohexa-1,3-dien-1-yl)methyl]acetamide;hydrochloride
N-butyl-N-[(5,6-dioxocyclohexa-1,3-dien-1-yl)methyl]acetamide;hydrochloride (PubChem CID 174401883) has the molecular formula C13H18ClNO3
and a molecular weight of 271.74 g/mol. Its IUPAC name is N-butyl-N-[(5,6-dioxocyclohexa-1,3-dien-1-yl)methyl]acetamide;hydrochloride.
Molecular Properties
| Compound Name | N-butyl-N-[(5,6-dioxocyclohexa-1,3-dien-1-yl)methyl]acetamide;hydrochloride |
| PubChem CID | 174401883 |
| Molecular Formula | C13H18ClNO3 |
| Molecular Weight | 271.74 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | N-butyl-N-[(5,6-dioxocyclohexa-1,3-dien-1-yl)methyl]acetamide;hydrochloride |
| SMILES | CCCCN(CC1=CC=CC(=O)C1=O)C(C)=O.Cl |
| InChI | InChI=1S/C13H17NO3.ClH/c1-3-4-8-14(10(2)15)9-11-6-5-7-12(16)13(11)17;/h5-7H,3-4,8-9H2,1-2H3;1H |
| InChIKey | DNAHCCDVWFLTPB-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.74 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-N-[(5,6-dioxocyclohexa-1,3-dien-1-yl)methyl]acetamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-N-[(5,6-dioxocyclohexa-1,3-dien-1-yl)methyl]acetamide;hydrochloride?
The IUPAC name of N-butyl-N-[(5,6-dioxocyclohexa-1,3-dien-1-yl)methyl]acetamide;hydrochloride (CID 174401883) is N-butyl-N-[(5,6-dioxocyclohexa-1,3-dien-1-yl)methyl]acetamide;hydrochloride.
What is the SMILES notation for N-butyl-N-[(5,6-dioxocyclohexa-1,3-dien-1-yl)methyl]acetamide;hydrochloride?
The canonical SMILES for N-butyl-N-[(5,6-dioxocyclohexa-1,3-dien-1-yl)methyl]acetamide;hydrochloride is CCCCN(CC1=CC=CC(=O)C1=O)C(C)=O.Cl.
What is the InChIKey of N-butyl-N-[(5,6-dioxocyclohexa-1,3-dien-1-yl)methyl]acetamide;hydrochloride?
The InChIKey is DNAHCCDVWFLTPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO3.ClH/c1-3-4-8-14(10(2)15)9-11-6-5-7-12(16)13(11)17;/h5-7H,3-4,8-9H2,1-2H3;1H.
What are the key properties of N-butyl-N-[(5,6-dioxocyclohexa-1,3-dien-1-yl)methyl]acetamide;hydrochloride?
N-butyl-N-[(5,6-dioxocyclohexa-1,3-dien-1-yl)methyl]acetamide;hydrochloride has a molecular weight of 271.74 g/mol, XLogP of 1.69, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-N-[(5,6-dioxocyclohexa-1,3-dien-1-yl)methyl]acetamide;hydrochloride is sourced from PubChem (CID 174401883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).