About 1,2,4,5-tetraiodohexane
1,2,4,5-tetraiodohexane (PubChem CID 174402213) has the molecular formula C6H10I4
and a molecular weight of 589.76 g/mol. Its IUPAC name is 1,2,4,5-tetraiodohexane.
Molecular Properties
| Compound Name | 1,2,4,5-tetraiodohexane |
| PubChem CID | 174402213 |
| Molecular Formula | C6H10I4 |
| Molecular Weight | 589.76 g/mol |
| Exact Mass | 589.70 |
| IUPAC Name | 1,2,4,5-tetraiodohexane |
| SMILES | CC(I)C(I)CC(I)CI |
| InChI | InChI=1S/C6H10I4/c1-4(8)6(10)2-5(9)3-7/h4-6H,2-3H2,1H3 |
| InChIKey | GTJMXHUZKZLTJW-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 589.76 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1,2,4,5-tetraiodohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,4,5-tetraiodohexane?
The IUPAC name of 1,2,4,5-tetraiodohexane (CID 174402213) is 1,2,4,5-tetraiodohexane.
What is the SMILES notation for 1,2,4,5-tetraiodohexane?
The canonical SMILES for 1,2,4,5-tetraiodohexane is CC(I)C(I)CC(I)CI.
What is the InChIKey of 1,2,4,5-tetraiodohexane?
The InChIKey is GTJMXHUZKZLTJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10I4/c1-4(8)6(10)2-5(9)3-7/h4-6H,2-3H2,1H3.
What are the key properties of 1,2,4,5-tetraiodohexane?
1,2,4,5-tetraiodohexane has a molecular weight of 589.76 g/mol, XLogP of 4.24, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,4,5-tetraiodohexane is sourced from PubChem (CID 174402213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).