C25H32N4O2 — CID 174402680
N-[1-[(2S)-2-amino-1-methyl-5-phenyl-2,3-dihydro-1,4-benzodiazepin-3-yl]-1-oxopropan-2-yl]hexanamide (PubChem CID 174402680) has the molecular formula C25H32N4O2 and a molecular weight of 420.56 g/mol. Its IUPAC name is N-[1-[(2S)-2-amino-1-methyl-5-phenyl-2,3-dihydro-1,4-benzodiazepin-3-yl]-1-oxopropan-2-yl]hexanamide.
| Compound Name | N-[1-[(2S)-2-amino-1-methyl-5-phenyl-2,3-dihydro-1,4-benzodiazepin-3-yl]-1-oxopropan-2-yl]hexanamide |
|---|---|
| PubChem CID | 174402680 |
| Molecular Formula | C25H32N4O2 |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | N-[1-[(2S)-2-amino-1-methyl-5-phenyl-2,3-dihydro-1,4-benzodiazepin-3-yl]-1-oxopropan-2-yl]hexanamide |
| SMILES | CCCCCC(=O)NC(C)C(=O)C1N=C(c2ccccc2)c2ccccc2N(C)[C@@H]1N |
| InChI | InChI=1S/C25H32N4O2/c1-4-5-7-16-21(30)27-17(2)24(31)23-25(26)29(3)20-15-11-10-14-19(20)22(28-23)18-12-8-6-9-13-18/h6,8-15,17,23,25H,4-5,7,16,26H2,1-3H3,(H,27,30)/t17?,23?,25-/m0/s1 |
| InChIKey | XURSUGVCMLVGHU-JOYOMSCZSA-N |
| XLogP | 3.28 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|