C14H23N2O2Si — CID 174402898
CID 174402898 (PubChem CID 174402898) has the molecular formula C14H23N2O2Si and a molecular weight of 279.44 g/mol.
| Compound Name | CID 174402898 |
|---|---|
| PubChem CID | 174402898 |
| Molecular Formula | C14H23N2O2Si |
| Molecular Weight | 279.44 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | — |
| SMILES | CO[Si](OC)N1CCCCC1c1cccc(CN)c1 |
| InChI | InChI=1S/C14H23N2O2Si/c1-17-19(18-2)16-9-4-3-8-14(16)13-7-5-6-12(10-13)11-15/h5-7,10,14H,3-4,8-9,11,15H2,1-2H3 |
| InChIKey | BSSISWYJECCUFG-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.44 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|