About cyclopenta-2,4-dien-1-ylphosphonic acid;cyclopentane;iron
cyclopenta-2,4-dien-1-ylphosphonic acid;cyclopentane;iron (PubChem CID 174402922) has the molecular formula C10H11FeO3P-6
and a molecular weight of 266.01 g/mol. Its IUPAC name is cyclopenta-2,4-dien-1-ylphosphonic acid;cyclopentane;iron.
Molecular Properties
| Compound Name | cyclopenta-2,4-dien-1-ylphosphonic acid;cyclopentane;iron |
| PubChem CID | 174402922 |
| Molecular Formula | C10H11FeO3P-6 |
| Molecular Weight | 266.01 g/mol |
| Exact Mass | 265.98 |
| IUPAC Name | cyclopenta-2,4-dien-1-ylphosphonic acid;cyclopentane;iron |
| SMILES | O=P(O)(O)[c-]1cccc1.[Fe].[cH-]1[cH-][cH-][cH-][cH-]1 |
| InChI | InChI=1S/C5H6O3P.C5H5.Fe/c6-9(7,8)5-3-1-2-4-5;1-2-4-5-3-1;/h1-4H,(H2,6,7,8);1-5H;/q-1;-5; |
| InChIKey | ZNUAZZZDUBENJQ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.01 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze cyclopenta-2,4-dien-1-ylphosphonic acid;cyclopentane;iron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenta-2,4-dien-1-ylphosphonic acid;cyclopentane;iron?
The IUPAC name of cyclopenta-2,4-dien-1-ylphosphonic acid;cyclopentane;iron (CID 174402922) is cyclopenta-2,4-dien-1-ylphosphonic acid;cyclopentane;iron.
What is the SMILES notation for cyclopenta-2,4-dien-1-ylphosphonic acid;cyclopentane;iron?
The canonical SMILES for cyclopenta-2,4-dien-1-ylphosphonic acid;cyclopentane;iron is O=P(O)(O)[c-]1cccc1.[Fe].[cH-]1[cH-][cH-][cH-][cH-]1.
What is the InChIKey of cyclopenta-2,4-dien-1-ylphosphonic acid;cyclopentane;iron?
The InChIKey is ZNUAZZZDUBENJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6O3P.C5H5.Fe/c6-9(7,8)5-3-1-2-4-5;1-2-4-5-3-1;/h1-4H,(H2,6,7,8);1-5H;/q-1;-5;.
What are the key properties of cyclopenta-2,4-dien-1-ylphosphonic acid;cyclopentane;iron?
cyclopenta-2,4-dien-1-ylphosphonic acid;cyclopentane;iron has a molecular weight of 266.01 g/mol, XLogP of 1.61, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenta-2,4-dien-1-ylphosphonic acid;cyclopentane;iron is sourced from PubChem (CID 174402922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).