C15H35N3O3Si — CID 174403131
3-[3,3-bis(2-aminoethyl)-1,1,2-trimethoxysilinan-2-yl]propan-1-amine (PubChem CID 174403131) has the molecular formula C15H35N3O3Si and a molecular weight of 333.55 g/mol. Its IUPAC name is 3-[3,3-bis(2-aminoethyl)-1,1,2-trimethoxysilinan-2-yl]propan-1-amine.
| Compound Name | 3-[3,3-bis(2-aminoethyl)-1,1,2-trimethoxysilinan-2-yl]propan-1-amine |
|---|---|
| PubChem CID | 174403131 |
| Molecular Formula | C15H35N3O3Si |
| Molecular Weight | 333.55 g/mol |
| Exact Mass | 333.24 |
| IUPAC Name | 3-[3,3-bis(2-aminoethyl)-1,1,2-trimethoxysilinan-2-yl]propan-1-amine |
| SMILES | COC1(CCCN)C(CCN)(CCN)CCC[Si]1(OC)OC |
| InChI | InChI=1S/C15H35N3O3Si/c1-19-15(7-4-10-16)14(8-11-17,9-12-18)6-5-13-22(15,20-2)21-3/h4-13,16-18H2,1-3H3 |
| InChIKey | GNOAUIMRXIIIQW-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 105.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.55 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|