About 4-chlorotriazine;cyclohexa-2,5-diene-1,4-dione
4-chlorotriazine;cyclohexa-2,5-diene-1,4-dione (PubChem CID 174403202) has the molecular formula C9H6ClN3O2
and a molecular weight of 223.62 g/mol. Its IUPAC name is 4-chlorotriazine;cyclohexa-2,5-diene-1,4-dione.
Molecular Properties
| Compound Name | 4-chlorotriazine;cyclohexa-2,5-diene-1,4-dione |
| PubChem CID | 174403202 |
| Molecular Formula | C9H6ClN3O2 |
| Molecular Weight | 223.62 g/mol |
| Exact Mass | 223.01 |
| IUPAC Name | 4-chlorotriazine;cyclohexa-2,5-diene-1,4-dione |
| SMILES | Clc1ccnnn1.O=C1C=CC(=O)C=C1 |
| InChI | InChI=1S/C6H4O2.C3H2ClN3/c7-5-1-2-6(8)4-3-5;4-3-1-2-5-7-6-3/h1-4H;1-2H |
| InChIKey | CNPVPEAWEPNMSZ-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 72.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.62 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|
Analyze 4-chlorotriazine;cyclohexa-2,5-diene-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chlorotriazine;cyclohexa-2,5-diene-1,4-dione?
The IUPAC name of 4-chlorotriazine;cyclohexa-2,5-diene-1,4-dione (CID 174403202) is 4-chlorotriazine;cyclohexa-2,5-diene-1,4-dione.
What is the SMILES notation for 4-chlorotriazine;cyclohexa-2,5-diene-1,4-dione?
The canonical SMILES for 4-chlorotriazine;cyclohexa-2,5-diene-1,4-dione is Clc1ccnnn1.O=C1C=CC(=O)C=C1.
What is the InChIKey of 4-chlorotriazine;cyclohexa-2,5-diene-1,4-dione?
The InChIKey is CNPVPEAWEPNMSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4O2.C3H2ClN3/c7-5-1-2-6(8)4-3-5;4-3-1-2-5-7-6-3/h1-4H;1-2H.
What are the key properties of 4-chlorotriazine;cyclohexa-2,5-diene-1,4-dione?
4-chlorotriazine;cyclohexa-2,5-diene-1,4-dione has a molecular weight of 223.62 g/mol, XLogP of 0.78, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chlorotriazine;cyclohexa-2,5-diene-1,4-dione is sourced from PubChem (CID 174403202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).