C25H32N2O2 — CID 174403366
tert-butyl N-[(2R,3R)-4-imino-3-methyl-1,7-diphenylhept-6-en-2-yl]carbamate (PubChem CID 174403366) has the molecular formula C25H32N2O2 and a molecular weight of 392.54 g/mol. Its IUPAC name is tert-butyl N-[(2R,3R)-4-imino-3-methyl-1,7-diphenylhept-6-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R,3R)-4-imino-3-methyl-1,7-diphenylhept-6-en-2-yl]carbamate |
|---|---|
| PubChem CID | 174403366 |
| Molecular Formula | C25H32N2O2 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.25 |
| IUPAC Name | tert-butyl N-[(2R,3R)-4-imino-3-methyl-1,7-diphenylhept-6-en-2-yl]carbamate |
| SMILES | [H]/N=C(\CC=Cc1ccccc1)[C@H](C)[C@@H](Cc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H32N2O2/c1-19(22(26)17-11-16-20-12-7-5-8-13-20)23(18-21-14-9-6-10-15-21)27-24(28)29-25(2,3)4/h5-16,19,23,26H,17-18H2,1-4H3,(H,27,28)/b16-11?,26-22+/t19-,23+/m0/s1 |
| InChIKey | AYKLIYHFXSIERS-KZILZCRXSA-N |
| XLogP | 5.88 |
| TPSA | 62.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|