About dicalcium;(1,2-dicarboxy-2-phosphonatooxyethyl) phosphate
dicalcium;(1,2-dicarboxy-2-phosphonatooxyethyl) phosphate (PubChem CID 174403491) has the molecular formula C4H4Ca2O12P2
and a molecular weight of 386.17 g/mol. Its IUPAC name is dicalcium;(1,2-dicarboxy-2-phosphonatooxyethyl) phosphate.
Molecular Properties
| Compound Name | dicalcium;(1,2-dicarboxy-2-phosphonatooxyethyl) phosphate |
| PubChem CID | 174403491 |
| Molecular Formula | C4H4Ca2O12P2 |
| Molecular Weight | 386.17 g/mol |
| Exact Mass | 385.84 |
| IUPAC Name | dicalcium;(1,2-dicarboxy-2-phosphonatooxyethyl) phosphate |
| SMILES | O=C(O)C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(=O)O.[Ca+2].[Ca+2] |
| InChI | InChI=1S/C4H8O12P2.2Ca/c5-3(6)1(15-17(9,10)11)2(4(7)8)16-18(12,13)14;;/h1-2H,(H,5,6)(H,7,8)(H2,9,10,11)(H2,12,13,14);;/q;2*+2/p-4 |
| InChIKey | VSWRGHQSAKVYRO-UHFFFAOYSA-J |
| XLogP | -5.18 |
| TPSA | 219.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.17 |
| LogP ≤ 5 | -5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dicalcium;(1,2-dicarboxy-2-phosphonatooxyethyl) phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dicalcium;(1,2-dicarboxy-2-phosphonatooxyethyl) phosphate?
The IUPAC name of dicalcium;(1,2-dicarboxy-2-phosphonatooxyethyl) phosphate (CID 174403491) is dicalcium;(1,2-dicarboxy-2-phosphonatooxyethyl) phosphate.
What is the SMILES notation for dicalcium;(1,2-dicarboxy-2-phosphonatooxyethyl) phosphate?
The canonical SMILES for dicalcium;(1,2-dicarboxy-2-phosphonatooxyethyl) phosphate is O=C(O)C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(=O)O.[Ca+2].[Ca+2].
What is the InChIKey of dicalcium;(1,2-dicarboxy-2-phosphonatooxyethyl) phosphate?
The InChIKey is VSWRGHQSAKVYRO-UHFFFAOYSA-J. The full InChI is InChI=1S/C4H8O12P2.2Ca/c5-3(6)1(15-17(9,10)11)2(4(7)8)16-18(12,13)14;;/h1-2H,(H,5,6)(H,7,8)(H2,9,10,11)(H2,12,13,14);;/q;2*+2/p-4.
What are the key properties of dicalcium;(1,2-dicarboxy-2-phosphonatooxyethyl) phosphate?
dicalcium;(1,2-dicarboxy-2-phosphonatooxyethyl) phosphate has a molecular weight of 386.17 g/mol, XLogP of -5.18, 7 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for dicalcium;(1,2-dicarboxy-2-phosphonatooxyethyl) phosphate is sourced from PubChem (CID 174403491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).