About pyrene;3,7,7-trimethylbicyclo[4.1.0]heptane
pyrene;3,7,7-trimethylbicyclo[4.1.0]heptane (PubChem CID 174403628) has the molecular formula C26H28
and a molecular weight of 340.51 g/mol. Its IUPAC name is pyrene;3,7,7-trimethylbicyclo[4.1.0]heptane.
Molecular Properties
| Compound Name | pyrene;3,7,7-trimethylbicyclo[4.1.0]heptane |
| PubChem CID | 174403628 |
| Molecular Formula | C26H28 |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | pyrene;3,7,7-trimethylbicyclo[4.1.0]heptane |
| SMILES | CC1CCC2C(C1)C2(C)C.c1cc2ccc3cccc4ccc(c1)c2c34 |
| InChI | InChI=1S/C16H10.C10H18/c1-3-11-7-9-13-5-2-6-14-10-8-12(4-1)15(11)16(13)14;1-7-4-5-8-9(6-7)10(8,2)3/h1-10H;7-9H,4-6H2,1-3H3 |
| InChIKey | WMRYUXOHYMUEGM-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze pyrene;3,7,7-trimethylbicyclo[4.1.0]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrene;3,7,7-trimethylbicyclo[4.1.0]heptane?
The IUPAC name of pyrene;3,7,7-trimethylbicyclo[4.1.0]heptane (CID 174403628) is pyrene;3,7,7-trimethylbicyclo[4.1.0]heptane.
What is the SMILES notation for pyrene;3,7,7-trimethylbicyclo[4.1.0]heptane?
The canonical SMILES for pyrene;3,7,7-trimethylbicyclo[4.1.0]heptane is CC1CCC2C(C1)C2(C)C.c1cc2ccc3cccc4ccc(c1)c2c34.
What is the InChIKey of pyrene;3,7,7-trimethylbicyclo[4.1.0]heptane?
The InChIKey is WMRYUXOHYMUEGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10.C10H18/c1-3-11-7-9-13-5-2-6-14-10-8-12(4-1)15(11)16(13)14;1-7-4-5-8-9(6-7)10(8,2)3/h1-10H;7-9H,4-6H2,1-3H3.
What are the key properties of pyrene;3,7,7-trimethylbicyclo[4.1.0]heptane?
pyrene;3,7,7-trimethylbicyclo[4.1.0]heptane has a molecular weight of 340.51 g/mol, XLogP of 7.66, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for pyrene;3,7,7-trimethylbicyclo[4.1.0]heptane is sourced from PubChem (CID 174403628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).