About 5-(2-butan-2-yl-1H-inden-1-id-4-yl)-1,2-dihydroacenaphthylene;dichlorozirconium
5-(2-butan-2-yl-1H-inden-1-id-4-yl)-1,2-dihydroacenaphthylene;dichlorozirconium (PubChem CID 174403714) has the molecular formula C25H23Cl2Zr-
and a molecular weight of 485.59 g/mol. Its IUPAC name is 5-(2-butan-2-yl-1H-inden-1-id-4-yl)-1,2-dihydroacenaphthylene;dichlorozirconium.
Molecular Properties
| Compound Name | 5-(2-butan-2-yl-1H-inden-1-id-4-yl)-1,2-dihydroacenaphthylene;dichlorozirconium |
| PubChem CID | 174403714 |
| Molecular Formula | C25H23Cl2Zr- |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 483.02 |
| IUPAC Name | 5-(2-butan-2-yl-1H-inden-1-id-4-yl)-1,2-dihydroacenaphthylene;dichlorozirconium |
| SMILES | CCC(C)c1cc2c(-c3ccc4c5c(cccc35)CC4)cccc2[cH-]1.Cl[Zr]Cl |
| InChI | InChI=1S/C25H23.2ClH.Zr/c1-3-16(2)20-14-19-7-5-8-21(24(19)15-20)22-13-12-18-11-10-17-6-4-9-23(22)25(17)18;;;/h4-9,12-16H,3,10-11H2,1-2H3;2*1H;/q-1;;;+2/p-2 |
| InChIKey | QXYYBFAMWKYHRF-UHFFFAOYSA-L |
| XLogP | 8.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 5-(2-butan-2-yl-1H-inden-1-id-4-yl)-1,2-dihydroacenaphthylene;dichlorozirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-butan-2-yl-1H-inden-1-id-4-yl)-1,2-dihydroacenaphthylene;dichlorozirconium?
The IUPAC name of 5-(2-butan-2-yl-1H-inden-1-id-4-yl)-1,2-dihydroacenaphthylene;dichlorozirconium (CID 174403714) is 5-(2-butan-2-yl-1H-inden-1-id-4-yl)-1,2-dihydroacenaphthylene;dichlorozirconium.
What is the SMILES notation for 5-(2-butan-2-yl-1H-inden-1-id-4-yl)-1,2-dihydroacenaphthylene;dichlorozirconium?
The canonical SMILES for 5-(2-butan-2-yl-1H-inden-1-id-4-yl)-1,2-dihydroacenaphthylene;dichlorozirconium is CCC(C)c1cc2c(-c3ccc4c5c(cccc35)CC4)cccc2[cH-]1.Cl[Zr]Cl.
What is the InChIKey of 5-(2-butan-2-yl-1H-inden-1-id-4-yl)-1,2-dihydroacenaphthylene;dichlorozirconium?
The InChIKey is QXYYBFAMWKYHRF-UHFFFAOYSA-L. The full InChI is InChI=1S/C25H23.2ClH.Zr/c1-3-16(2)20-14-19-7-5-8-21(24(19)15-20)22-13-12-18-11-10-17-6-4-9-23(22)25(17)18;;;/h4-9,12-16H,3,10-11H2,1-2H3;2*1H;/q-1;;;+2/p-2.
What are the key properties of 5-(2-butan-2-yl-1H-inden-1-id-4-yl)-1,2-dihydroacenaphthylene;dichlorozirconium?
5-(2-butan-2-yl-1H-inden-1-id-4-yl)-1,2-dihydroacenaphthylene;dichlorozirconium has a molecular weight of 485.59 g/mol, XLogP of 8.37, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-butan-2-yl-1H-inden-1-id-4-yl)-1,2-dihydroacenaphthylene;dichlorozirconium is sourced from PubChem (CID 174403714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).