About 1-ethynyl-3-(2,3,4-trimethylphenyl)cyclohexan-1-amine
1-ethynyl-3-(2,3,4-trimethylphenyl)cyclohexan-1-amine (PubChem CID 174403784) has the molecular formula C17H23N
and a molecular weight of 241.38 g/mol. Its IUPAC name is 1-ethynyl-3-(2,3,4-trimethylphenyl)cyclohexan-1-amine.
Molecular Properties
| Compound Name | 1-ethynyl-3-(2,3,4-trimethylphenyl)cyclohexan-1-amine |
| PubChem CID | 174403784 |
| Molecular Formula | C17H23N |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | 1-ethynyl-3-(2,3,4-trimethylphenyl)cyclohexan-1-amine |
| SMILES | C#CC1(N)CCCC(c2ccc(C)c(C)c2C)C1 |
| InChI | InChI=1S/C17H23N/c1-5-17(18)10-6-7-15(11-17)16-9-8-12(2)13(3)14(16)4/h1,8-9,15H,6-7,10-11,18H2,2-4H3 |
| InChIKey | OGNCBMOPFBCWGC-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-ethynyl-3-(2,3,4-trimethylphenyl)cyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethynyl-3-(2,3,4-trimethylphenyl)cyclohexan-1-amine?
The IUPAC name of 1-ethynyl-3-(2,3,4-trimethylphenyl)cyclohexan-1-amine (CID 174403784) is 1-ethynyl-3-(2,3,4-trimethylphenyl)cyclohexan-1-amine.
What is the SMILES notation for 1-ethynyl-3-(2,3,4-trimethylphenyl)cyclohexan-1-amine?
The canonical SMILES for 1-ethynyl-3-(2,3,4-trimethylphenyl)cyclohexan-1-amine is C#CC1(N)CCCC(c2ccc(C)c(C)c2C)C1.
What is the InChIKey of 1-ethynyl-3-(2,3,4-trimethylphenyl)cyclohexan-1-amine?
The InChIKey is OGNCBMOPFBCWGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N/c1-5-17(18)10-6-7-15(11-17)16-9-8-12(2)13(3)14(16)4/h1,8-9,15H,6-7,10-11,18H2,2-4H3.
What are the key properties of 1-ethynyl-3-(2,3,4-trimethylphenyl)cyclohexan-1-amine?
1-ethynyl-3-(2,3,4-trimethylphenyl)cyclohexan-1-amine has a molecular weight of 241.38 g/mol, XLogP of 3.60, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethynyl-3-(2,3,4-trimethylphenyl)cyclohexan-1-amine is sourced from PubChem (CID 174403784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).