About 1-chlorooctane;sulfuryl dichloride
1-chlorooctane;sulfuryl dichloride (PubChem CID 174404842) has the molecular formula C8H17Cl3O2S
and a molecular weight of 283.65 g/mol. Its IUPAC name is 1-chlorooctane;sulfuryl dichloride.
Molecular Properties
| Compound Name | 1-chlorooctane;sulfuryl dichloride |
| PubChem CID | 174404842 |
| Molecular Formula | C8H17Cl3O2S |
| Molecular Weight | 283.65 g/mol |
| Exact Mass | 282.00 |
| IUPAC Name | 1-chlorooctane;sulfuryl dichloride |
| SMILES | CCCCCCCCCl.O=S(=O)(Cl)Cl |
| InChI | InChI=1S/C8H17Cl.Cl2O2S/c1-2-3-4-5-6-7-8-9;1-5(2,3)4/h2-8H2,1H3; |
| InChIKey | MCFKNTDEXJUBME-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.65 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-chlorooctane;sulfuryl dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chlorooctane;sulfuryl dichloride?
The IUPAC name of 1-chlorooctane;sulfuryl dichloride (CID 174404842) is 1-chlorooctane;sulfuryl dichloride.
What is the SMILES notation for 1-chlorooctane;sulfuryl dichloride?
The canonical SMILES for 1-chlorooctane;sulfuryl dichloride is CCCCCCCCCl.O=S(=O)(Cl)Cl.
What is the InChIKey of 1-chlorooctane;sulfuryl dichloride?
The InChIKey is MCFKNTDEXJUBME-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17Cl.Cl2O2S/c1-2-3-4-5-6-7-8-9;1-5(2,3)4/h2-8H2,1H3;.
What are the key properties of 1-chlorooctane;sulfuryl dichloride?
1-chlorooctane;sulfuryl dichloride has a molecular weight of 283.65 g/mol, XLogP of 4.29, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chlorooctane;sulfuryl dichloride is sourced from PubChem (CID 174404842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).