About azetidin-2-one;1-deuterio-2-phenylbenzene
azetidin-2-one;1-deuterio-2-phenylbenzene (PubChem CID 174405166) has the molecular formula C15H15NO
and a molecular weight of 226.30 g/mol. Its IUPAC name is azetidin-2-one;1-deuterio-2-phenylbenzene.
Molecular Properties
| Compound Name | azetidin-2-one;1-deuterio-2-phenylbenzene |
| PubChem CID | 174405166 |
| Molecular Formula | C15H15NO |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | azetidin-2-one;1-deuterio-2-phenylbenzene |
| SMILES | O=C1CCN1.[2H]c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C12H10.C3H5NO/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;5-3-1-2-4-3/h1-10H;1-2H2,(H,4,5)/i7D; |
| InChIKey | LPYHGKRVJNCAFQ-DRGWXPQLSA-N |
| XLogP | 2.86 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze azetidin-2-one;1-deuterio-2-phenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azetidin-2-one;1-deuterio-2-phenylbenzene?
The IUPAC name of azetidin-2-one;1-deuterio-2-phenylbenzene (CID 174405166) is azetidin-2-one;1-deuterio-2-phenylbenzene.
What is the SMILES notation for azetidin-2-one;1-deuterio-2-phenylbenzene?
The canonical SMILES for azetidin-2-one;1-deuterio-2-phenylbenzene is O=C1CCN1.[2H]c1ccccc1-c1ccccc1.
What is the InChIKey of azetidin-2-one;1-deuterio-2-phenylbenzene?
The InChIKey is LPYHGKRVJNCAFQ-DRGWXPQLSA-N. The full InChI is InChI=1S/C12H10.C3H5NO/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;5-3-1-2-4-3/h1-10H;1-2H2,(H,4,5)/i7D;.
What are the key properties of azetidin-2-one;1-deuterio-2-phenylbenzene?
azetidin-2-one;1-deuterio-2-phenylbenzene has a molecular weight of 226.30 g/mol, XLogP of 2.86, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azetidin-2-one;1-deuterio-2-phenylbenzene is sourced from PubChem (CID 174405166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).