About 5,5-bis(prop-2-enyl)cyclohexa-1,3-diene
5,5-bis(prop-2-enyl)cyclohexa-1,3-diene (PubChem CID 174405622) has the molecular formula C12H16
and a molecular weight of 160.26 g/mol. Its IUPAC name is 5,5-bis(prop-2-enyl)cyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 5,5-bis(prop-2-enyl)cyclohexa-1,3-diene |
| PubChem CID | 174405622 |
| Molecular Formula | C12H16 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.13 |
| IUPAC Name | 5,5-bis(prop-2-enyl)cyclohexa-1,3-diene |
| SMILES | C=CCC1(CC=C)C=CC=CC1 |
| InChI | InChI=1S/C12H16/c1-3-8-12(9-4-2)10-6-5-7-11-12/h3-7,10H,1-2,8-9,11H2 |
| InChIKey | RMFBJVBZSLNTLF-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5,5-bis(prop-2-enyl)cyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-bis(prop-2-enyl)cyclohexa-1,3-diene?
The IUPAC name of 5,5-bis(prop-2-enyl)cyclohexa-1,3-diene (CID 174405622) is 5,5-bis(prop-2-enyl)cyclohexa-1,3-diene.
What is the SMILES notation for 5,5-bis(prop-2-enyl)cyclohexa-1,3-diene?
The canonical SMILES for 5,5-bis(prop-2-enyl)cyclohexa-1,3-diene is C=CCC1(CC=C)C=CC=CC1.
What is the InChIKey of 5,5-bis(prop-2-enyl)cyclohexa-1,3-diene?
The InChIKey is RMFBJVBZSLNTLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16/c1-3-8-12(9-4-2)10-6-5-7-11-12/h3-7,10H,1-2,8-9,11H2.
What are the key properties of 5,5-bis(prop-2-enyl)cyclohexa-1,3-diene?
5,5-bis(prop-2-enyl)cyclohexa-1,3-diene has a molecular weight of 160.26 g/mol, XLogP of 3.64, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-bis(prop-2-enyl)cyclohexa-1,3-diene is sourced from PubChem (CID 174405622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).