About 3-[2-[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]sulfanylethyl]-4-methyl-1,3-thiazol-2-one
3-[2-[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]sulfanylethyl]-4-methyl-1,3-thiazol-2-one (PubChem CID 17440577) has the molecular formula C15H17N5OS2
and a molecular weight of 347.47 g/mol. Its IUPAC name is 3-[2-[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]sulfanylethyl]-4-methyl-1,3-thiazol-2-one.
Molecular Properties
| Compound Name | 3-[2-[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]sulfanylethyl]-4-methyl-1,3-thiazol-2-one |
| PubChem CID | 17440577 |
| Molecular Formula | C15H17N5OS2 |
| Molecular Weight | 347.47 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 3-[2-[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]sulfanylethyl]-4-methyl-1,3-thiazol-2-one |
| SMILES | Cc1cc(C)n(-c2ccc(SCCn3c(C)csc3=O)nn2)n1 |
| InChI | InChI=1S/C15H17N5OS2/c1-10-8-11(2)20(18-10)13-4-5-14(17-16-13)22-7-6-19-12(3)9-23-15(19)21/h4-5,8-9H,6-7H2,1-3H3 |
| InChIKey | ZRGIBIJGANJMAN-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 65.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.47 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 3-[2-[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]sulfanylethyl]-4-methyl-1,3-thiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]sulfanylethyl]-4-methyl-1,3-thiazol-2-one?
The IUPAC name of 3-[2-[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]sulfanylethyl]-4-methyl-1,3-thiazol-2-one (CID 17440577) is 3-[2-[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]sulfanylethyl]-4-methyl-1,3-thiazol-2-one.
What is the SMILES notation for 3-[2-[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]sulfanylethyl]-4-methyl-1,3-thiazol-2-one?
The canonical SMILES for 3-[2-[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]sulfanylethyl]-4-methyl-1,3-thiazol-2-one is Cc1cc(C)n(-c2ccc(SCCn3c(C)csc3=O)nn2)n1.
What is the InChIKey of 3-[2-[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]sulfanylethyl]-4-methyl-1,3-thiazol-2-one?
The InChIKey is ZRGIBIJGANJMAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N5OS2/c1-10-8-11(2)20(18-10)13-4-5-14(17-16-13)22-7-6-19-12(3)9-23-15(19)21/h4-5,8-9H,6-7H2,1-3H3.
What are the key properties of 3-[2-[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]sulfanylethyl]-4-methyl-1,3-thiazol-2-one?
3-[2-[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]sulfanylethyl]-4-methyl-1,3-thiazol-2-one has a molecular weight of 347.47 g/mol, XLogP of 2.60, 5 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]sulfanylethyl]-4-methyl-1,3-thiazol-2-one is sourced from PubChem (CID 17440577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).