C24H32FN3O — CID 174405792
2-[1-(1-ethylpiperidin-4-yl)-2,3-dihydroindol-6-yl]-2-(methylamino)acetaldehyde;fluorobenzene (PubChem CID 174405792) has the molecular formula C24H32FN3O and a molecular weight of 397.54 g/mol. Its IUPAC name is 2-[1-(1-ethylpiperidin-4-yl)-2,3-dihydroindol-6-yl]-2-(methylamino)acetaldehyde;fluorobenzene.
| Compound Name | 2-[1-(1-ethylpiperidin-4-yl)-2,3-dihydroindol-6-yl]-2-(methylamino)acetaldehyde;fluorobenzene |
|---|---|
| PubChem CID | 174405792 |
| Molecular Formula | C24H32FN3O |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.25 |
| IUPAC Name | 2-[1-(1-ethylpiperidin-4-yl)-2,3-dihydroindol-6-yl]-2-(methylamino)acetaldehyde;fluorobenzene |
| SMILES | CCN1CCC(N2CCc3ccc(C(C=O)NC)cc32)CC1.Fc1ccccc1 |
| InChI | InChI=1S/C18H27N3O.C6H5F/c1-3-20-9-7-16(8-10-20)21-11-6-14-4-5-15(12-18(14)21)17(13-22)19-2;7-6-4-2-1-3-5-6/h4-5,12-13,16-17,19H,3,6-11H2,1-2H3;1-5H |
| InChIKey | VHPCSIHIRPNZPD-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|