About 6-methylhept-5-ene-1,4-diimine
6-methylhept-5-ene-1,4-diimine (PubChem CID 174406199) has the molecular formula C8H14N2
and a molecular weight of 138.21 g/mol. Its IUPAC name is 6-methylhept-5-ene-1,4-diimine.
Molecular Properties
| Compound Name | 6-methylhept-5-ene-1,4-diimine |
| PubChem CID | 174406199 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | 6-methylhept-5-ene-1,4-diimine |
| SMILES | [H]/N=C/CC/C(C=C(C)C)=N\[H] |
| InChI | InChI=1S/C8H14N2/c1-7(2)6-8(10)4-3-5-9/h5-6,9-10H,3-4H2,1-2H3/b9-5+,10-8+ |
| InChIKey | QRRMBDWEIIDYKM-MUDDOMJDSA-N |
| XLogP | 2.40 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 6-methylhept-5-ene-1,4-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylhept-5-ene-1,4-diimine?
The IUPAC name of 6-methylhept-5-ene-1,4-diimine (CID 174406199) is 6-methylhept-5-ene-1,4-diimine.
What is the SMILES notation for 6-methylhept-5-ene-1,4-diimine?
The canonical SMILES for 6-methylhept-5-ene-1,4-diimine is [H]/N=C/CC/C(C=C(C)C)=N\[H].
What is the InChIKey of 6-methylhept-5-ene-1,4-diimine?
The InChIKey is QRRMBDWEIIDYKM-MUDDOMJDSA-N. The full InChI is InChI=1S/C8H14N2/c1-7(2)6-8(10)4-3-5-9/h5-6,9-10H,3-4H2,1-2H3/b9-5+,10-8+.
What are the key properties of 6-methylhept-5-ene-1,4-diimine?
6-methylhept-5-ene-1,4-diimine has a molecular weight of 138.21 g/mol, XLogP of 2.40, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylhept-5-ene-1,4-diimine is sourced from PubChem (CID 174406199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).