About [5-(2-chlorophenyl)-1,2-oxazol-4-yl] formate
[5-(2-chlorophenyl)-1,2-oxazol-4-yl] formate (PubChem CID 174407084) has the molecular formula C10H6ClNO3
and a molecular weight of 223.62 g/mol. Its IUPAC name is [5-(2-chlorophenyl)-1,2-oxazol-4-yl] formate.
Molecular Properties
| Compound Name | [5-(2-chlorophenyl)-1,2-oxazol-4-yl] formate |
| PubChem CID | 174407084 |
| Molecular Formula | C10H6ClNO3 |
| Molecular Weight | 223.62 g/mol |
| Exact Mass | 223.00 |
| IUPAC Name | [5-(2-chlorophenyl)-1,2-oxazol-4-yl] formate |
| SMILES | O=COc1cnoc1-c1ccccc1Cl |
| InChI | InChI=1S/C10H6ClNO3/c11-8-4-2-1-3-7(8)10-9(14-6-13)5-12-15-10/h1-6H |
| InChIKey | GBDNGARMDKYLES-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.62 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze [5-(2-chlorophenyl)-1,2-oxazol-4-yl] formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(2-chlorophenyl)-1,2-oxazol-4-yl] formate?
The IUPAC name of [5-(2-chlorophenyl)-1,2-oxazol-4-yl] formate (CID 174407084) is [5-(2-chlorophenyl)-1,2-oxazol-4-yl] formate.
What is the SMILES notation for [5-(2-chlorophenyl)-1,2-oxazol-4-yl] formate?
The canonical SMILES for [5-(2-chlorophenyl)-1,2-oxazol-4-yl] formate is O=COc1cnoc1-c1ccccc1Cl.
What is the InChIKey of [5-(2-chlorophenyl)-1,2-oxazol-4-yl] formate?
The InChIKey is GBDNGARMDKYLES-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6ClNO3/c11-8-4-2-1-3-7(8)10-9(14-6-13)5-12-15-10/h1-6H.
What are the key properties of [5-(2-chlorophenyl)-1,2-oxazol-4-yl] formate?
[5-(2-chlorophenyl)-1,2-oxazol-4-yl] formate has a molecular weight of 223.62 g/mol, XLogP of 2.53, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(2-chlorophenyl)-1,2-oxazol-4-yl] formate is sourced from PubChem (CID 174407084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).