About 10H-acridin-9-one;2-methylquinoline;naphthalene-2-sulfonic acid
10H-acridin-9-one;2-methylquinoline;naphthalene-2-sulfonic acid (PubChem CID 174407426) has the molecular formula C33H26N2O4S
and a molecular weight of 546.65 g/mol. Its IUPAC name is 10H-acridin-9-one;2-methylquinoline;naphthalene-2-sulfonic acid.
Molecular Properties
| Compound Name | 10H-acridin-9-one;2-methylquinoline;naphthalene-2-sulfonic acid |
| PubChem CID | 174407426 |
| Molecular Formula | C33H26N2O4S |
| Molecular Weight | 546.65 g/mol |
| Exact Mass | 546.16 |
| IUPAC Name | 10H-acridin-9-one;2-methylquinoline;naphthalene-2-sulfonic acid |
| SMILES | Cc1ccc2ccccc2n1.O=S(=O)(O)c1ccc2ccccc2c1.O=c1c2ccccc2[nH]c2ccccc12 |
| InChI | InChI=1S/C13H9NO.C10H9N.C10H8O3S/c15-13-9-5-1-3-7-11(9)14-12-8-4-2-6-10(12)13;1-8-6-7-9-4-2-3-5-10(9)11-8;11-14(12,13)10-6-5-8-3-1-2-4-9(8)7-10/h1-8H,(H,14,15);2-7H,1H3;1-7H,(H,11,12,13) |
| InChIKey | GNTWUPHNYMIZGW-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 100.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 546.65 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 10H-acridin-9-one;2-methylquinoline;naphthalene-2-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10H-acridin-9-one;2-methylquinoline;naphthalene-2-sulfonic acid?
The IUPAC name of 10H-acridin-9-one;2-methylquinoline;naphthalene-2-sulfonic acid (CID 174407426) is 10H-acridin-9-one;2-methylquinoline;naphthalene-2-sulfonic acid.
What is the SMILES notation for 10H-acridin-9-one;2-methylquinoline;naphthalene-2-sulfonic acid?
The canonical SMILES for 10H-acridin-9-one;2-methylquinoline;naphthalene-2-sulfonic acid is Cc1ccc2ccccc2n1.O=S(=O)(O)c1ccc2ccccc2c1.O=c1c2ccccc2[nH]c2ccccc12.
What is the InChIKey of 10H-acridin-9-one;2-methylquinoline;naphthalene-2-sulfonic acid?
The InChIKey is GNTWUPHNYMIZGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9NO.C10H9N.C10H8O3S/c15-13-9-5-1-3-7-11(9)14-12-8-4-2-6-10(12)13;1-8-6-7-9-4-2-3-5-10(9)11-8;11-14(12,13)10-6-5-8-3-1-2-4-9(8)7-10/h1-8H,(H,14,15);2-7H,1H3;1-7H,(H,11,12,13).
What are the key properties of 10H-acridin-9-one;2-methylquinoline;naphthalene-2-sulfonic acid?
10H-acridin-9-one;2-methylquinoline;naphthalene-2-sulfonic acid has a molecular weight of 546.65 g/mol, XLogP of 7.31, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 10H-acridin-9-one;2-methylquinoline;naphthalene-2-sulfonic acid is sourced from PubChem (CID 174407426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).