About methyl 4-(ethenylamino)-6,6-diethylcyclohexa-2,4-diene-1-carboxylate
methyl 4-(ethenylamino)-6,6-diethylcyclohexa-2,4-diene-1-carboxylate (PubChem CID 174407472) has the molecular formula C14H21NO2
and a molecular weight of 235.33 g/mol. Its IUPAC name is methyl 4-(ethenylamino)-6,6-diethylcyclohexa-2,4-diene-1-carboxylate.
Molecular Properties
| Compound Name | methyl 4-(ethenylamino)-6,6-diethylcyclohexa-2,4-diene-1-carboxylate |
| PubChem CID | 174407472 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | methyl 4-(ethenylamino)-6,6-diethylcyclohexa-2,4-diene-1-carboxylate |
| SMILES | C=CNC1=CC(CC)(CC)C(C(=O)OC)C=C1 |
| InChI | InChI=1S/C14H21NO2/c1-5-14(6-2)10-11(15-7-3)8-9-12(14)13(16)17-4/h7-10,12,15H,3,5-6H2,1-2,4H3 |
| InChIKey | HROQDEUQUFSBIU-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 4-(ethenylamino)-6,6-diethylcyclohexa-2,4-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(ethenylamino)-6,6-diethylcyclohexa-2,4-diene-1-carboxylate?
The IUPAC name of methyl 4-(ethenylamino)-6,6-diethylcyclohexa-2,4-diene-1-carboxylate (CID 174407472) is methyl 4-(ethenylamino)-6,6-diethylcyclohexa-2,4-diene-1-carboxylate.
What is the SMILES notation for methyl 4-(ethenylamino)-6,6-diethylcyclohexa-2,4-diene-1-carboxylate?
The canonical SMILES for methyl 4-(ethenylamino)-6,6-diethylcyclohexa-2,4-diene-1-carboxylate is C=CNC1=CC(CC)(CC)C(C(=O)OC)C=C1.
What is the InChIKey of methyl 4-(ethenylamino)-6,6-diethylcyclohexa-2,4-diene-1-carboxylate?
The InChIKey is HROQDEUQUFSBIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO2/c1-5-14(6-2)10-11(15-7-3)8-9-12(14)13(16)17-4/h7-10,12,15H,3,5-6H2,1-2,4H3.
What are the key properties of methyl 4-(ethenylamino)-6,6-diethylcyclohexa-2,4-diene-1-carboxylate?
methyl 4-(ethenylamino)-6,6-diethylcyclohexa-2,4-diene-1-carboxylate has a molecular weight of 235.33 g/mol, XLogP of 2.77, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(ethenylamino)-6,6-diethylcyclohexa-2,4-diene-1-carboxylate is sourced from PubChem (CID 174407472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).