C45H44N4O — CID 174407832
9H-carbazole;6-phenylmethoxy-3-[2-(1-propan-2-ylpyrazol-4-yl)ethyl]-1,2,3,4-tetrahydrochrysen-1-amine (PubChem CID 174407832) has the molecular formula C45H44N4O and a molecular weight of 656.87 g/mol. Its IUPAC name is 9H-carbazole;6-phenylmethoxy-3-[2-(1-propan-2-ylpyrazol-4-yl)ethyl]-1,2,3,4-tetrahydrochrysen-1-amine.
| Compound Name | 9H-carbazole;6-phenylmethoxy-3-[2-(1-propan-2-ylpyrazol-4-yl)ethyl]-1,2,3,4-tetrahydrochrysen-1-amine |
|---|---|
| PubChem CID | 174407832 |
| Molecular Formula | C45H44N4O |
| Molecular Weight | 656.87 g/mol |
| Exact Mass | 656.35 |
| IUPAC Name | 9H-carbazole;6-phenylmethoxy-3-[2-(1-propan-2-ylpyrazol-4-yl)ethyl]-1,2,3,4-tetrahydrochrysen-1-amine |
| SMILES | CC(C)n1cc(CCC2Cc3c(ccc4c3cc(OCc3ccccc3)c3ccccc34)C(N)C2)cn1.c1ccc2c(c1)[nH]c1ccccc12 |
| InChI | InChI=1S/C33H35N3O.C12H9N/c1-22(2)36-20-25(19-35-36)13-12-24-16-30-28(32(34)17-24)15-14-27-26-10-6-7-11-29(26)33(18-31(27)30)37-21-23-8-4-3-5-9-23;1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11/h3-11,14-15,18-20,22,24,32H,12-13,16-17,21,34H2,1-2H3;1-8,13H |
| InChIKey | PYHVKHCQZJJKIW-UHFFFAOYSA-N |
| XLogP | 10.87 |
| TPSA | 68.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.87 |
| LogP ≤ 5 | 10.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|