About formaldehyde;4-phenylbenzene-1,3-diol
formaldehyde;4-phenylbenzene-1,3-diol (PubChem CID 174408267) has the molecular formula C13H12O3
and a molecular weight of 216.24 g/mol. Its IUPAC name is formaldehyde;4-phenylbenzene-1,3-diol.
Molecular Properties
| Compound Name | formaldehyde;4-phenylbenzene-1,3-diol |
| PubChem CID | 174408267 |
| Molecular Formula | C13H12O3 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | formaldehyde;4-phenylbenzene-1,3-diol |
| SMILES | C=O.Oc1ccc(-c2ccccc2)c(O)c1 |
| InChI | InChI=1S/C12H10O2.CH2O/c13-10-6-7-11(12(14)8-10)9-4-2-1-3-5-9;1-2/h1-8,13-14H;1H2 |
| InChIKey | SAVILYUANXGLID-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze formaldehyde;4-phenylbenzene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formaldehyde;4-phenylbenzene-1,3-diol?
The IUPAC name of formaldehyde;4-phenylbenzene-1,3-diol (CID 174408267) is formaldehyde;4-phenylbenzene-1,3-diol.
What is the SMILES notation for formaldehyde;4-phenylbenzene-1,3-diol?
The canonical SMILES for formaldehyde;4-phenylbenzene-1,3-diol is C=O.Oc1ccc(-c2ccccc2)c(O)c1.
What is the InChIKey of formaldehyde;4-phenylbenzene-1,3-diol?
The InChIKey is SAVILYUANXGLID-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O2.CH2O/c13-10-6-7-11(12(14)8-10)9-4-2-1-3-5-9;1-2/h1-8,13-14H;1H2.
What are the key properties of formaldehyde;4-phenylbenzene-1,3-diol?
formaldehyde;4-phenylbenzene-1,3-diol has a molecular weight of 216.24 g/mol, XLogP of 2.58, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for formaldehyde;4-phenylbenzene-1,3-diol is sourced from PubChem (CID 174408267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).