About 3-[2-(diethylamino)ethyl]-2-prop-2-enylphenol;formaldehyde
3-[2-(diethylamino)ethyl]-2-prop-2-enylphenol;formaldehyde (PubChem CID 174409044) has the molecular formula C16H25NO2
and a molecular weight of 263.38 g/mol. Its IUPAC name is 3-[2-(diethylamino)ethyl]-2-prop-2-enylphenol;formaldehyde.
Molecular Properties
| Compound Name | 3-[2-(diethylamino)ethyl]-2-prop-2-enylphenol;formaldehyde |
| PubChem CID | 174409044 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | 3-[2-(diethylamino)ethyl]-2-prop-2-enylphenol;formaldehyde |
| SMILES | C=CCc1c(O)cccc1CCN(CC)CC.C=O |
| InChI | InChI=1S/C15H23NO.CH2O/c1-4-8-14-13(9-7-10-15(14)17)11-12-16(5-2)6-3;1-2/h4,7,9-10,17H,1,5-6,8,11-12H2,2-3H3;1H2 |
| InChIKey | DCZUKLIHGIULDL-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-(diethylamino)ethyl]-2-prop-2-enylphenol;formaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(diethylamino)ethyl]-2-prop-2-enylphenol;formaldehyde?
The IUPAC name of 3-[2-(diethylamino)ethyl]-2-prop-2-enylphenol;formaldehyde (CID 174409044) is 3-[2-(diethylamino)ethyl]-2-prop-2-enylphenol;formaldehyde.
What is the SMILES notation for 3-[2-(diethylamino)ethyl]-2-prop-2-enylphenol;formaldehyde?
The canonical SMILES for 3-[2-(diethylamino)ethyl]-2-prop-2-enylphenol;formaldehyde is C=CCc1c(O)cccc1CCN(CC)CC.C=O.
What is the InChIKey of 3-[2-(diethylamino)ethyl]-2-prop-2-enylphenol;formaldehyde?
The InChIKey is DCZUKLIHGIULDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO.CH2O/c1-4-8-14-13(9-7-10-15(14)17)11-12-16(5-2)6-3;1-2/h4,7,9-10,17H,1,5-6,8,11-12H2,2-3H3;1H2.
What are the key properties of 3-[2-(diethylamino)ethyl]-2-prop-2-enylphenol;formaldehyde?
3-[2-(diethylamino)ethyl]-2-prop-2-enylphenol;formaldehyde has a molecular weight of 263.38 g/mol, XLogP of 2.82, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(diethylamino)ethyl]-2-prop-2-enylphenol;formaldehyde is sourced from PubChem (CID 174409044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).