About 1H-imidazole;5-methylbenzene-1,3-dicarboxylic acid
1H-imidazole;5-methylbenzene-1,3-dicarboxylic acid (PubChem CID 174409186) has the molecular formula C12H12N2O4
and a molecular weight of 248.24 g/mol. Its IUPAC name is 1H-imidazole;5-methylbenzene-1,3-dicarboxylic acid.
Molecular Properties
| Compound Name | 1H-imidazole;5-methylbenzene-1,3-dicarboxylic acid |
| PubChem CID | 174409186 |
| Molecular Formula | C12H12N2O4 |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 1H-imidazole;5-methylbenzene-1,3-dicarboxylic acid |
| SMILES | Cc1cc(C(=O)O)cc(C(=O)O)c1.c1c[nH]cn1 |
| InChI | InChI=1S/C9H8O4.C3H4N2/c1-5-2-6(8(10)11)4-7(3-5)9(12)13;1-2-5-3-4-1/h2-4H,1H3,(H,10,11)(H,12,13);1-3H,(H,4,5) |
| InChIKey | ZOMQQIKKTNUXSE-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 103.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1H-imidazole;5-methylbenzene-1,3-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-imidazole;5-methylbenzene-1,3-dicarboxylic acid?
The IUPAC name of 1H-imidazole;5-methylbenzene-1,3-dicarboxylic acid (CID 174409186) is 1H-imidazole;5-methylbenzene-1,3-dicarboxylic acid.
What is the SMILES notation for 1H-imidazole;5-methylbenzene-1,3-dicarboxylic acid?
The canonical SMILES for 1H-imidazole;5-methylbenzene-1,3-dicarboxylic acid is Cc1cc(C(=O)O)cc(C(=O)O)c1.c1c[nH]cn1.
What is the InChIKey of 1H-imidazole;5-methylbenzene-1,3-dicarboxylic acid?
The InChIKey is ZOMQQIKKTNUXSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O4.C3H4N2/c1-5-2-6(8(10)11)4-7(3-5)9(12)13;1-2-5-3-4-1/h2-4H,1H3,(H,10,11)(H,12,13);1-3H,(H,4,5).
What are the key properties of 1H-imidazole;5-methylbenzene-1,3-dicarboxylic acid?
1H-imidazole;5-methylbenzene-1,3-dicarboxylic acid has a molecular weight of 248.24 g/mol, XLogP of 1.80, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-imidazole;5-methylbenzene-1,3-dicarboxylic acid is sourced from PubChem (CID 174409186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).