About 5,6,7-trimethoxy-2-propyl-1,3-benzothiazole
5,6,7-trimethoxy-2-propyl-1,3-benzothiazole (PubChem CID 174409284) has the molecular formula C13H17NO3S
and a molecular weight of 267.35 g/mol. Its IUPAC name is 5,6,7-trimethoxy-2-propyl-1,3-benzothiazole.
Molecular Properties
| Compound Name | 5,6,7-trimethoxy-2-propyl-1,3-benzothiazole |
| PubChem CID | 174409284 |
| Molecular Formula | C13H17NO3S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 5,6,7-trimethoxy-2-propyl-1,3-benzothiazole |
| SMILES | CCCc1nc2cc(OC)c(OC)c(OC)c2s1 |
| InChI | InChI=1S/C13H17NO3S/c1-5-6-10-14-8-7-9(15-2)11(16-3)12(17-4)13(8)18-10/h7H,5-6H2,1-4H3 |
| InChIKey | WFYKDUDIIVVWSP-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5,6,7-trimethoxy-2-propyl-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6,7-trimethoxy-2-propyl-1,3-benzothiazole?
The IUPAC name of 5,6,7-trimethoxy-2-propyl-1,3-benzothiazole (CID 174409284) is 5,6,7-trimethoxy-2-propyl-1,3-benzothiazole.
What is the SMILES notation for 5,6,7-trimethoxy-2-propyl-1,3-benzothiazole?
The canonical SMILES for 5,6,7-trimethoxy-2-propyl-1,3-benzothiazole is CCCc1nc2cc(OC)c(OC)c(OC)c2s1.
What is the InChIKey of 5,6,7-trimethoxy-2-propyl-1,3-benzothiazole?
The InChIKey is WFYKDUDIIVVWSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO3S/c1-5-6-10-14-8-7-9(15-2)11(16-3)12(17-4)13(8)18-10/h7H,5-6H2,1-4H3.
What are the key properties of 5,6,7-trimethoxy-2-propyl-1,3-benzothiazole?
5,6,7-trimethoxy-2-propyl-1,3-benzothiazole has a molecular weight of 267.35 g/mol, XLogP of 3.27, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6,7-trimethoxy-2-propyl-1,3-benzothiazole is sourced from PubChem (CID 174409284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).