C11H5BrCl4N4OS — CID 174409475
5-amino-4-[bromo(chloro)methyl]sulfinyl-1-(2,4,6-trichlorophenyl)pyrazole-3-carbonitrile (PubChem CID 174409475) has the molecular formula C11H5BrCl4N4OS and a molecular weight of 462.97 g/mol. Its IUPAC name is 5-amino-4-[bromo(chloro)methyl]sulfinyl-1-(2,4,6-trichlorophenyl)pyrazole-3-carbonitrile.
| Compound Name | 5-amino-4-[bromo(chloro)methyl]sulfinyl-1-(2,4,6-trichlorophenyl)pyrazole-3-carbonitrile |
|---|---|
| PubChem CID | 174409475 |
| Molecular Formula | C11H5BrCl4N4OS |
| Molecular Weight | 462.97 g/mol |
| Exact Mass | 459.81 |
| IUPAC Name | 5-amino-4-[bromo(chloro)methyl]sulfinyl-1-(2,4,6-trichlorophenyl)pyrazole-3-carbonitrile |
| SMILES | N#Cc1nn(-c2c(Cl)cc(Cl)cc2Cl)c(N)c1S(=O)C(Cl)Br |
| InChI | InChI=1S/C11H5BrCl4N4OS/c12-11(16)22(21)9-7(3-17)19-20(10(9)18)8-5(14)1-4(13)2-6(8)15/h1-2,11H,18H2 |
| InChIKey | CUTVWIGINCYPEZ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 84.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.97 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|