C11H25N2O10PS — CID 174409853
2-amino-4-methylsulfanylbutanoic acid;[(2R,3S,4R,5R)-5-amino-3,4,6-trihydroxyoxan-2-yl]methyl dihydrogen phosphate (PubChem CID 174409853) has the molecular formula C11H25N2O10PS and a molecular weight of 408.37 g/mol. Its IUPAC name is 2-amino-4-methylsulfanylbutanoic acid;[(2R,3S,4R,5R)-5-amino-3,4,6-trihydroxyoxan-2-yl]methyl dihydrogen phosphate.
| Compound Name | 2-amino-4-methylsulfanylbutanoic acid;[(2R,3S,4R,5R)-5-amino-3,4,6-trihydroxyoxan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 174409853 |
| Molecular Formula | C11H25N2O10PS |
| Molecular Weight | 408.37 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | 2-amino-4-methylsulfanylbutanoic acid;[(2R,3S,4R,5R)-5-amino-3,4,6-trihydroxyoxan-2-yl]methyl dihydrogen phosphate |
| SMILES | CSCCC(N)C(=O)O.N[C@H]1C(O)O[C@H](COP(=O)(O)O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H14NO8P.C5H11NO2S/c7-3-5(9)4(8)2(15-6(3)10)1-14-16(11,12)13;1-9-3-2-4(6)5(7)8/h2-6,8-10H,1,7H2,(H2,11,12,13);4H,2-3,6H2,1H3,(H,7,8)/t2-,3-,4-,5-,6?;/m1./s1 |
| InChIKey | PRBGQZPDPPVVER-NSEZLWDYSA-N |
| XLogP | -2.99 |
| TPSA | 226.02 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.37 |
| LogP ≤ 5 | -2.99 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|