About 6-azabicyclo[3.1.1]hepta-1(6),2,4-triene;fluoro carbonofluoridate
6-azabicyclo[3.1.1]hepta-1(6),2,4-triene;fluoro carbonofluoridate (PubChem CID 174410413) has the molecular formula C7H5F2NO2
and a molecular weight of 173.12 g/mol. Its IUPAC name is 6-azabicyclo[3.1.1]hepta-1(6),2,4-triene;fluoro carbonofluoridate.
Molecular Properties
| Compound Name | 6-azabicyclo[3.1.1]hepta-1(6),2,4-triene;fluoro carbonofluoridate |
| PubChem CID | 174410413 |
| Molecular Formula | C7H5F2NO2 |
| Molecular Weight | 173.12 g/mol |
| Exact Mass | 173.03 |
| IUPAC Name | 6-azabicyclo[3.1.1]hepta-1(6),2,4-triene;fluoro carbonofluoridate |
| SMILES | O=C(F)OF.c1cc2nc(c1)C2 |
| InChI | InChI=1S/C6H5N.CF2O2/c1-2-5-4-6(3-1)7-5;2-1(4)5-3/h1-3H,4H2; |
| InChIKey | FRMYBOZEHIYVKX-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.12 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-azabicyclo[3.1.1]hepta-1(6),2,4-triene;fluoro carbonofluoridate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-azabicyclo[3.1.1]hepta-1(6),2,4-triene;fluoro carbonofluoridate?
The IUPAC name of 6-azabicyclo[3.1.1]hepta-1(6),2,4-triene;fluoro carbonofluoridate (CID 174410413) is 6-azabicyclo[3.1.1]hepta-1(6),2,4-triene;fluoro carbonofluoridate.
What is the SMILES notation for 6-azabicyclo[3.1.1]hepta-1(6),2,4-triene;fluoro carbonofluoridate?
The canonical SMILES for 6-azabicyclo[3.1.1]hepta-1(6),2,4-triene;fluoro carbonofluoridate is O=C(F)OF.c1cc2nc(c1)C2.
What is the InChIKey of 6-azabicyclo[3.1.1]hepta-1(6),2,4-triene;fluoro carbonofluoridate?
The InChIKey is FRMYBOZEHIYVKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N.CF2O2/c1-2-5-4-6(3-1)7-5;2-1(4)5-3/h1-3H,4H2;.
What are the key properties of 6-azabicyclo[3.1.1]hepta-1(6),2,4-triene;fluoro carbonofluoridate?
6-azabicyclo[3.1.1]hepta-1(6),2,4-triene;fluoro carbonofluoridate has a molecular weight of 173.12 g/mol, XLogP of 1.96, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-azabicyclo[3.1.1]hepta-1(6),2,4-triene;fluoro carbonofluoridate is sourced from PubChem (CID 174410413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).