About 1,2-dimethylimidazole;isoindole-1,3-dione
1,2-dimethylimidazole;isoindole-1,3-dione (PubChem CID 174411656) has the molecular formula C13H13N3O2
and a molecular weight of 243.27 g/mol. Its IUPAC name is 1,2-dimethylimidazole;isoindole-1,3-dione.
Molecular Properties
| Compound Name | 1,2-dimethylimidazole;isoindole-1,3-dione |
| PubChem CID | 174411656 |
| Molecular Formula | C13H13N3O2 |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 1,2-dimethylimidazole;isoindole-1,3-dione |
| SMILES | Cc1nccn1C.O=C1NC(=O)c2ccccc21 |
| InChI | InChI=1S/C8H5NO2.C5H8N2/c10-7-5-3-1-2-4-6(5)8(11)9-7;1-5-6-3-4-7(5)2/h1-4H,(H,9,10,11);3-4H,1-2H3 |
| InChIKey | NTEXTPPGOKUCGH-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dimethylimidazole;isoindole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethylimidazole;isoindole-1,3-dione?
The IUPAC name of 1,2-dimethylimidazole;isoindole-1,3-dione (CID 174411656) is 1,2-dimethylimidazole;isoindole-1,3-dione.
What is the SMILES notation for 1,2-dimethylimidazole;isoindole-1,3-dione?
The canonical SMILES for 1,2-dimethylimidazole;isoindole-1,3-dione is Cc1nccn1C.O=C1NC(=O)c2ccccc21.
What is the InChIKey of 1,2-dimethylimidazole;isoindole-1,3-dione?
The InChIKey is NTEXTPPGOKUCGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5NO2.C5H8N2/c10-7-5-3-1-2-4-6(5)8(11)9-7;1-5-6-3-4-7(5)2/h1-4H,(H,9,10,11);3-4H,1-2H3.
What are the key properties of 1,2-dimethylimidazole;isoindole-1,3-dione?
1,2-dimethylimidazole;isoindole-1,3-dione has a molecular weight of 243.27 g/mol, XLogP of 1.30, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethylimidazole;isoindole-1,3-dione is sourced from PubChem (CID 174411656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).