C18H21N3O4 — CID 17441178
2-(4-cyano-2-methoxyphenoxy)-N-(5-methyl-1,2-oxazol-3-yl)hexanamide (PubChem CID 17441178) has the molecular formula C18H21N3O4 and a molecular weight of 343.38 g/mol. Its IUPAC name is 2-(4-cyano-2-methoxyphenoxy)-N-(5-methyl-1,2-oxazol-3-yl)hexanamide.
| Compound Name | 2-(4-cyano-2-methoxyphenoxy)-N-(5-methyl-1,2-oxazol-3-yl)hexanamide |
|---|---|
| PubChem CID | 17441178 |
| Molecular Formula | C18H21N3O4 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 2-(4-cyano-2-methoxyphenoxy)-N-(5-methyl-1,2-oxazol-3-yl)hexanamide |
| SMILES | CCCCC(Oc1ccc(C#N)cc1OC)C(=O)Nc1cc(C)on1 |
| InChI | InChI=1S/C18H21N3O4/c1-4-5-6-15(18(22)20-17-9-12(2)25-21-17)24-14-8-7-13(11-19)10-16(14)23-3/h7-10,15H,4-6H2,1-3H3,(H,20,21,22) |
| InChIKey | XMSGCAXOIZKTLV-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |