C12H13BrN2O5P+ — CID 174411799
7-bromo-5-but-3-enyl-1,4-dihydroquinoxaline-2,3-dione;dihydroxy(oxo)phosphanium (PubChem CID 174411799) has the molecular formula C12H13BrN2O5P+ and a molecular weight of 376.12 g/mol. Its IUPAC name is 7-bromo-5-but-3-enyl-1,4-dihydroquinoxaline-2,3-dione;dihydroxy(oxo)phosphanium.
| Compound Name | 7-bromo-5-but-3-enyl-1,4-dihydroquinoxaline-2,3-dione;dihydroxy(oxo)phosphanium |
|---|---|
| PubChem CID | 174411799 |
| Molecular Formula | C12H13BrN2O5P+ |
| Molecular Weight | 376.12 g/mol |
| Exact Mass | 374.97 |
| IUPAC Name | 7-bromo-5-but-3-enyl-1,4-dihydroquinoxaline-2,3-dione;dihydroxy(oxo)phosphanium |
| SMILES | C=CCCc1cc(Br)cc2[nH]c(=O)c(=O)[nH]c12.O=[P+](O)O |
| InChI | InChI=1S/C12H11BrN2O2.HO3P/c1-2-3-4-7-5-8(13)6-9-10(7)15-12(17)11(16)14-9;1-4(2)3/h2,5-6H,1,3-4H2,(H,14,16)(H,15,17);(H-,1,2,3)/p+1 |
| InChIKey | BTPBBCHAHUEIOM-UHFFFAOYSA-O |
| XLogP | 1.73 |
| TPSA | 123.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.12 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|