About 3-(2,3-diphenylphenyl)thiophene;fluoroform;sulfane
3-(2,3-diphenylphenyl)thiophene;fluoroform;sulfane (PubChem CID 174411937) has the molecular formula C23H19F3S2
and a molecular weight of 416.53 g/mol. Its IUPAC name is 3-(2,3-diphenylphenyl)thiophene;fluoroform;sulfane.
Molecular Properties
| Compound Name | 3-(2,3-diphenylphenyl)thiophene;fluoroform;sulfane |
| PubChem CID | 174411937 |
| Molecular Formula | C23H19F3S2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | 3-(2,3-diphenylphenyl)thiophene;fluoroform;sulfane |
| SMILES | FC(F)F.S.c1ccc(-c2cccc(-c3ccsc3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C22H16S.CHF3.H2S/c1-3-8-17(9-4-1)20-12-7-13-21(19-14-15-23-16-19)22(20)18-10-5-2-6-11-18;2-1(3)4;/h1-16H;1H;1H2 |
| InChIKey | XUBCKIGYVNOBFY-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(2,3-diphenylphenyl)thiophene;fluoroform;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,3-diphenylphenyl)thiophene;fluoroform;sulfane?
The IUPAC name of 3-(2,3-diphenylphenyl)thiophene;fluoroform;sulfane (CID 174411937) is 3-(2,3-diphenylphenyl)thiophene;fluoroform;sulfane.
What is the SMILES notation for 3-(2,3-diphenylphenyl)thiophene;fluoroform;sulfane?
The canonical SMILES for 3-(2,3-diphenylphenyl)thiophene;fluoroform;sulfane is FC(F)F.S.c1ccc(-c2cccc(-c3ccsc3)c2-c2ccccc2)cc1.
What is the InChIKey of 3-(2,3-diphenylphenyl)thiophene;fluoroform;sulfane?
The InChIKey is XUBCKIGYVNOBFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16S.CHF3.H2S/c1-3-8-17(9-4-1)20-12-7-13-21(19-14-15-23-16-19)22(20)18-10-5-2-6-11-18;2-1(3)4;/h1-16H;1H;1H2.
What are the key properties of 3-(2,3-diphenylphenyl)thiophene;fluoroform;sulfane?
3-(2,3-diphenylphenyl)thiophene;fluoroform;sulfane has a molecular weight of 416.53 g/mol, XLogP of 8.04, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,3-diphenylphenyl)thiophene;fluoroform;sulfane is sourced from PubChem (CID 174411937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).