C24H23FN2 — CID 174412192
7-fluoro-4,6-dimethyl-1,2,3,4-tetrahydrochrysene;pyrazine (PubChem CID 174412192) has the molecular formula C24H23FN2 and a molecular weight of 358.46 g/mol. Its IUPAC name is 7-fluoro-4,6-dimethyl-1,2,3,4-tetrahydrochrysene;pyrazine.
| Compound Name | 7-fluoro-4,6-dimethyl-1,2,3,4-tetrahydrochrysene;pyrazine |
|---|---|
| PubChem CID | 174412192 |
| Molecular Formula | C24H23FN2 |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 7-fluoro-4,6-dimethyl-1,2,3,4-tetrahydrochrysene;pyrazine |
| SMILES | Cc1cc2c3c(ccc2c2cccc(F)c12)CCCC3C.c1cnccn1 |
| InChI | InChI=1S/C20H19F.C4H4N2/c1-12-5-3-6-14-9-10-15-16-7-4-8-18(21)20(16)13(2)11-17(15)19(12)14;1-2-6-4-3-5-1/h4,7-12H,3,5-6H2,1-2H3;1-4H |
| InChIKey | BONBVEZEJINGAA-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|