About [3-(5-cyclopropyl-1H-pyrazol-4-yl)-1,1,1-trifluoropropan-2-yl] formate
[3-(5-cyclopropyl-1H-pyrazol-4-yl)-1,1,1-trifluoropropan-2-yl] formate (PubChem CID 174412758) has the molecular formula C10H11F3N2O2
and a molecular weight of 248.20 g/mol. Its IUPAC name is [3-(5-cyclopropyl-1H-pyrazol-4-yl)-1,1,1-trifluoropropan-2-yl] formate.
Molecular Properties
| Compound Name | [3-(5-cyclopropyl-1H-pyrazol-4-yl)-1,1,1-trifluoropropan-2-yl] formate |
| PubChem CID | 174412758 |
| Molecular Formula | C10H11F3N2O2 |
| Molecular Weight | 248.20 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | [3-(5-cyclopropyl-1H-pyrazol-4-yl)-1,1,1-trifluoropropan-2-yl] formate |
| SMILES | O=COC(Cc1cn[nH]c1C1CC1)C(F)(F)F |
| InChI | InChI=1S/C10H11F3N2O2/c11-10(12,13)8(17-5-16)3-7-4-14-15-9(7)6-1-2-6/h4-6,8H,1-3H2,(H,14,15) |
| InChIKey | HULRSICRCXMWMY-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.20 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze [3-(5-cyclopropyl-1H-pyrazol-4-yl)-1,1,1-trifluoropropan-2-yl] formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(5-cyclopropyl-1H-pyrazol-4-yl)-1,1,1-trifluoropropan-2-yl] formate?
The IUPAC name of [3-(5-cyclopropyl-1H-pyrazol-4-yl)-1,1,1-trifluoropropan-2-yl] formate (CID 174412758) is [3-(5-cyclopropyl-1H-pyrazol-4-yl)-1,1,1-trifluoropropan-2-yl] formate.
What is the SMILES notation for [3-(5-cyclopropyl-1H-pyrazol-4-yl)-1,1,1-trifluoropropan-2-yl] formate?
The canonical SMILES for [3-(5-cyclopropyl-1H-pyrazol-4-yl)-1,1,1-trifluoropropan-2-yl] formate is O=COC(Cc1cn[nH]c1C1CC1)C(F)(F)F.
What is the InChIKey of [3-(5-cyclopropyl-1H-pyrazol-4-yl)-1,1,1-trifluoropropan-2-yl] formate?
The InChIKey is HULRSICRCXMWMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11F3N2O2/c11-10(12,13)8(17-5-16)3-7-4-14-15-9(7)6-1-2-6/h4-6,8H,1-3H2,(H,14,15).
What are the key properties of [3-(5-cyclopropyl-1H-pyrazol-4-yl)-1,1,1-trifluoropropan-2-yl] formate?
[3-(5-cyclopropyl-1H-pyrazol-4-yl)-1,1,1-trifluoropropan-2-yl] formate has a molecular weight of 248.20 g/mol, XLogP of 1.93, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(5-cyclopropyl-1H-pyrazol-4-yl)-1,1,1-trifluoropropan-2-yl] formate is sourced from PubChem (CID 174412758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).