C15H23NO2S — CID 174412816
2-[(1S,4R)-2-ethyl-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-2-thiocyanatoacetic acid (PubChem CID 174412816) has the molecular formula C15H23NO2S and a molecular weight of 281.42 g/mol. Its IUPAC name is 2-[(1S,4R)-2-ethyl-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-2-thiocyanatoacetic acid.
| Compound Name | 2-[(1S,4R)-2-ethyl-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-2-thiocyanatoacetic acid |
|---|---|
| PubChem CID | 174412816 |
| Molecular Formula | C15H23NO2S |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 2-[(1S,4R)-2-ethyl-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-2-thiocyanatoacetic acid |
| SMILES | CCC1(C(SC#N)C(=O)O)C[C@H]2CC[C@@]1(C)C2(C)C |
| InChI | InChI=1S/C15H23NO2S/c1-5-15(11(12(17)18)19-9-16)8-10-6-7-14(15,4)13(10,2)3/h10-11H,5-8H2,1-4H3,(H,17,18)/t10-,11?,14+,15?/m1/s1 |
| InChIKey | SYVJNWPKFYNBPO-XJZOAQGMSA-N |
| XLogP | 3.90 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|